loading...| Preferred Name |
Brivaracetam |
|
| Synonyms |
2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide brivaracetam Briviact UCB 34714 UCB34714 (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide |
|
| Definitions |
A non-proteinogenic amino acid derivative that is butanamide in which the pro-S hydrogen at position 2 is replaced by a (4R)-2-oxo-4-propylpyrrolidin-1-yl. Used for treatment of partial onset seizures related to epilepsy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_133013 |
|
| alternative label |
2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide brivaracetam Briviact UCB 34714 UCB34714 (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide |
|
| charge |
0 |
|
| database_cross_reference |
PMID:27192732 CAS:357336-20-0 PMID:26664121 PMID:27274002 PMID:27236448 PMID:27217762 Reaxys:9629290 PMID:26944275 PMID:26920914 PMID:26760311 PMID:27450143 Drug_Central:5068 PMID:27389600 PMID:27265725 PMID:26891946 PMID:26666500 KEGG:D08879 PMID:27146213 PMID:26719676 PMID:27252986 PMID:27335114 PMID:26740317 PMID:26899665 PMID:27403785 PMID:27002062 PMID:27346728 PMID:27221208 Wikipedia:Brivaracetam PMID:27503181 PMID:26515103 |
|
| definition |
A non-proteinogenic amino acid derivative that is butanamide in which the pro-S hydrogen at position 2 is replaced by a (4R)-2-oxo-4-propylpyrrolidin-1-yl. Used for treatment of partial onset seizures related to epilepsy. |
|
| formula |
C11H20N2O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
(2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide brivaracetam Briviact UCB 34714 UCB34714 |
|
| has_RxCUI |
1739745 |
|
| id |
CHEBI:133013 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9+/m1/s1 |
|
| inchikey |
MSYKRHVOOPPJKU-BDAKNGLRSA-N |
|
| label |
Brivaracetam brivaracetam |
|
| mass |
212.289 |
|
| monoisotopicmass |
212.15248 |
|
| notation |
CHEBI:133013 |
|
| prefLabel |
Brivaracetam |
|
| smiles |
N1([C@H](C(N)=O)CC)C(C[C@H](C1)CCC)=O |
|
| subClassOf |