loading...| Preferred Name |
gemifloxacin |
|
| Synonyms |
7-[3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid gemifloxacin |
|
| Definitions |
A 1,4-dihydro-1,8-naphthyridine with a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a substituted pyrrolin-1-yl group at the 7-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_101853 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:1286 Beilstein:8361408 CAS:175463-14-6 KEGG:D08012 Wikipedia:Gemifloxacin Patent:EP688772 Patent:US5633262 DrugBank:DB01155 |
|
| definition |
A 1,4-dihydro-1,8-naphthyridine with a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a substituted pyrrolin-1-yl group at the 7-position. |
|
| formula |
C18H20FN5O4 |
|
| has role | ||
| has_exact_synonym |
7-[3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
gemifloxacin |
|
| has_RxCUI |
138099 |
|
| id |
CHEBI:101853 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H20FN5O4/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27)/b22-14+ |
|
| inchikey |
ZRCVYEYHRGVLOC-HYARGMPZSA-N |
|
| label |
gemifloxacin |
|
| mass |
389.38090 |
|
| monoisotopicmass |
389.14993 |
|
| notation |
CHEBI:101853 |
|
| prefLabel |
gemifloxacin |
|
| smiles |
CO\N=C1/CN(CC1CN)c1nc2n(cc(C(O)=O)c(=O)c2cc1F)C1CC1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_73537 http://purl.obolibrary.org/obo/CHEBI_87211 |