loading...| Preferred Name |
xylometazoline |
|
| Synonyms |
C16H24N2 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06694 |
|
| activates |
http://purl.obolibrary.org/obo/dinto_4020 http://purl.obolibrary.org/obo/dinto_3475 http://purl.obolibrary.org/obo/dinto_3877 http://purl.obolibrary.org/obo/dinto_1581 |
|
| AHFScode |
52:32.00 |
|
| ATCCode |
R01AB06 S01GA03 R01AA07 |
|
| CASRN |
526-36-3 |
|
| DBBrand |
otrivine otrix otrivin otriven |
|
| DBSynonym |
xylomethazoline |
|
| Definition |
A nasal vasoconstricting decongestant drug which acts by binding to the same receptors as adrenaline. It is applied as a spray or as drops into the nose to ease inflammation and congestion of the nasal passageways. It binds alpha-adrenergic receptors to activate the adrenal system which causes systemic vasoconstriction, thereby easing nasal congestion. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_3877 |
|
| InChI |
InChI=1S/C16H24N2/c1-11-8-13(16(3,4)5)9-12(2)14(11)10-15-17-6-7-18-15/h8-9H,6-7,10H2,1-5H3,(H,17,18) |
|
| InChIKey |
InChIKey=HUCJFAOMUPXHDK-UHFFFAOYSA-N |
|
| label |
xylometazoline |
|
| prefixIRI |
obo2:dinto_DB06694 |
|
| prefLabel |
xylometazoline |
|
| SMILES |
CC1=CC(=CC(C)=C1CC1=NCCN1)C(C)(C)C |
|
| Synonym |
C16H24N2 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole |
|
| xref |
IUPHAR:517 PharmGKB:PA165958368 Wikipedia:http://en.wikipedia.org/wiki/Xylometazoline ChemSpider:5507 PubChem Compound:5709 RxList:http://nosesprays.info/result.php?Keyword Guide To Pharmacology:517 PubChem Substance:99443248 BindingDB:50027068 |
|
| subClassOf |