loading...| Preferred Name |
naftifine |
| Synonyms |
methyl(naphthalen-1-ylmethyl)(3-phenylprop-2-en-1-yl)amine C21H21N |
| ID |
http://purl.obolibrary.org/obo/dinto_DB00735 |
| AHFScode |
84:04.08.04 |
| ATCCode |
D01AE22 |
| CASRN |
65472-88-0 |
| DBBrand |
naftifine hcl naftin |
| Definition |
Naftifine is a synthetic, broad spectrum, antifungal agent and allylamine derivative for the topical treatment of tinea pedis, tinea cruris, and tinea corporis caused by the organisms Trichophyton rubrum, Trichophyton mentagrophytes, Trichophyton tonsurans and Epidermophyton floccosum. |
| has effect |
http://purl.obolibrary.org/obo/OAE_0000645 |
| has pharmacological target | |
| InChI |
InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+ |
| InChIKey |
InChIKey=OZGNYLLQHRPOBR-DHZHZOJOSA-N |
| inhibits | |
| label |
naftifine |
| prefixIRI |
obo2:dinto_DB00735 |
| prefLabel |
naftifine |
| SMILES |
CN(CC=CC1=CC=CC=C1)CC1=CC=CC2=CC=CC=C12 |
| Synonym |
methyl(naphthalen-1-ylmethyl)(3-phenylprop-2-en-1-yl)amine C21H21N |
| xref |
PubChem Substance:46504777 ChemSpider:66071 RxList:http://www.rxlist.com/cgi/generic2/naft.htm Wikipedia:http://en.wikipedia.org/wiki/Naftifine PharmGKB:PA164748617 PubChem Compound:47641 National Drug Code Directory:0259-4770-40 Drugs.com:http://www.drugs.com/cdi/naftifine-cream.html Drugs Product Database (DPD):2011255 |
| subClassOf |