loading...| Preferred Name |
lindane |
|
| Synonyms |
C6H6Cl6 (1R,2S,3r,4R,5S,6r)-1,2,3,4,5,6-hexachlorocyclohexane |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00431 |
|
| AHFScode |
84:04.12 84:04.92 |
|
| ATCCode |
D08AE01 P03AB02 |
|
| blocks |
http://purl.obolibrary.org/obo/dinto_0742 http://purl.obolibrary.org/obo/dinto_2725 http://purl.obolibrary.org/obo/dinto_1453 |
|
| CASRN |
58-89-9 |
|
| DBBrand |
spritz-rapidin hortex thionex atlas steward nexit-stark neo-scabicidol lindafor gammexane mszycol pedraczak lidenal gexane spruehpflanzol hexicide owadziak lendine scabene hexa nicochloran gamacid aparasin codechine devoran nexol-e tri-6 heclotox gammaterr isotox ovadziak aalindan viton entomoxan streunex milbol 49 kwell scabene lotion bexol lentox gammalin omnitox hexit gammalin 20 linvur arbitex nexit aplidal lintox agrocide wp gammasan pflanzol agrocide iii esoderm lindosep lindatox lindex jacutin bentox 10 aphtiria indane aficide hexatox ameisentod chloresene kokotine hexyclan nexen fb lorexane celanex new kotol ben-hex quellada agrocide hexaverm gamene |
|
| DBSynonym |
lindan gamma-hch ?-hexachlorocyclohexane gamma-bhc ?-benzene hexachloride ?-hch ?-lindane ?-bhc benzene hexachloride gamma-hexachlorocyclohexane ?-hexachlorzyklohexan |
|
| Definition |
An organochlorine insecticide that has been used as a pediculicide and a scabicide. Lindane has been banned in California, United Kingdom, Australia, and many western countries due to concerns about neurotoxicity and adverse effects on the environment. In Canada, Lindane is not recommmended as a first-line therapy due to reports of resistance, neurotoxicity, and bone marrow suppression, but has been approved by the FDA as a second-line therapy for topical treatment of pediculosis capitis (head lice), pediculosis pubis (pubic lice), or scabies in patients greater than two years of age who cannot tolerate or have failed first-line treatment. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000388 http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0000376 http://purl.obolibrary.org/obo/OAE_0000415 http://purl.obolibrary.org/obo/OAE_0000373 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+ |
|
| InChIKey |
InChIKey=JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
|
| label |
lindane |
|
| prefixIRI |
obo2:dinto_DB00431 |
|
| prefLabel |
lindane |
|
| SMILES |
Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl |
|
| Synonym |
C6H6Cl6 (1R,2S,3r,4R,5S,6r)-1,2,3,4,5,6-hexachlorocyclohexane |
|
| xref |
Drugs.com:http://www.drugs.com/cdi/lindane-lotion.html ChEBI:32888 RxList:http://www.rxlist.com/cgi/generic2/lindane.htm Drugs Product Database (DPD):703605 Wikipedia:http://en.wikipedia.org/wiki/Lindane PharmGKB:PA164754914 National Drug Code Directory:45068-100-01 |
|
| subClassOf |