loading...| Preferred Name |
benzophenone |
|
| Synonyms |
benzoylbenzene benzophenone alpha-oxoditane Ph2CO DIPHENYLMETHANONE Benzophenone alpha-oxodiphenylmethane C13H10O diphenylmethanone Diphenyl ketone |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41308 |
|
| altId |
CHEBI:3034 CHEBI:41306 |
|
| CASRN |
119-61-9 |
|
| DBname |
benzophenone |
|
| DBSynonym |
benzoylbenzene phenyl ketone diphenylmethanone diphenyl ketone |
|
| Definition |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
| has role | ||
| InChI |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
|
| InChIKey |
InChIKey=RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|
| label |
benzophenone |
|
| prefixIRI |
obo2:CHEBI_41308 |
|
| prefLabel |
benzophenone |
|
| SMILES |
O=C(C1=CC=CC=C1)C1=CC=CC=C1 O=C(c1ccccc1)c1ccccc1 |
|
| Synonym |
benzoylbenzene benzophenone alpha-oxoditane Ph2CO DIPHENYLMETHANONE Benzophenone alpha-oxodiphenylmethane C13H10O diphenylmethanone Diphenyl ketone |
|
| xref |
CASRN:119-61-9 Wikipedia:Benzophenone PDB:BZQ Gmelin:4256 Beilstein:1238185 CiteXplore:17439666 BindingDB:22726 DrugBank:DB01878 CiteXplore:21238557 Wikipedia:http://en.wikipedia.org/wiki/Benzophenone PDBeChem:BZQ ChEBI:3034 ChemSpider:2991 NIST Chemistry WebBook:119-61-9 Reaxys:1238185 CiteXplore:21277784 PubChem Substance:46507784 KEGG COMPOUND:C06354 CiteXplore:20534002 CiteXplore:21919502 ChEMBL:247656 PubChem Compound:3102 CiteXplore:19939518 |
|
| subClassOf |