loading...| Preferred Name |
chlorphenesin |
|
| Synonyms |
3-(4-chlorophenoxy)-1,2-propanediol Chlorphenesin C9H11ClO3 glycerol alpha-p-chlorophenyl ether 3-(p-chlorophenoxy)-1,2-propanediol clorfenesina chlorphenesine p-chlorophenyl-alpha-glyceryl ether 3-(p-chlorophenoxy)propane-1,2-diol 3-(4-chlorophenoxy)propane-1,2-diol chlorphenesinum chlorphenesin |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3642 |
|
| altId |
CHEBI:480431 CHEBI:704618 |
|
| ATCCode |
D01AE07 |
|
| CASRN |
104-29-0 |
|
| DBBrand |
gechophen maolate mycil adermykon demykon gecophen |
|
| DBname |
chlorphenesin |
|
| DBSynonym |
chlorphenesine [inn-french] chlorphenesinum [inn-latin] p-chlorophenyl chlorophenesin p-chlorophenyl glyceryl ether clorfenesina [inn-spanish] alpha-glyceryl ether |
|
| Definition |
Glycerol in which the hydrogen of one of the primary hydroxy groups is substituted by a 4-chlorophenyl group. It has antifungal and antibacterial properties, and is used for treatment of cutaneous and vaginal infections. Its 1-carbamate is used as a skeletal muscle relaxant for the treatment of painful muscle spasm. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
| InChI |
InChI=1S/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
|
| InChIKey |
InChIKey=MXOAEAUPQDYUQM-UHFFFAOYSA-N |
|
| induces |
http://purl.obolibrary.org/obo/dinto_3102 http://purl.obolibrary.org/obo/dinto_0901 |
|
| inhibits | ||
| label |
chlorphenesin |
|
| prefixIRI |
obo2:CHEBI_3642 |
|
| prefLabel |
chlorphenesin |
|
| SMILES |
OCC(O)COc1ccc(Cl)cc1 OCC(O)COC1=CC=C(Cl)C=C1 |
|
| Synonym |
3-(4-chlorophenoxy)-1,2-propanediol Chlorphenesin C9H11ClO3 glycerol alpha-p-chlorophenyl ether 3-(p-chlorophenoxy)-1,2-propanediol clorfenesina chlorphenesine p-chlorophenyl-alpha-glyceryl ether 3-(p-chlorophenoxy)propane-1,2-diol 3-(4-chlorophenoxy)propane-1,2-diol chlorphenesinum chlorphenesin |
|
| xref |
Reaxys:2210845 Beilstein:2210845 Patent:GB628497 Patent:US2468423 Drugs.com:http://www.drugs.com/mtm/chlorphenesin.html CASRN:104-29-0 ChemSpider:7411 Wikipedia:Chlorphenesin PubChem Compound:7697 ChEMBL:17178228 DrugBank:DB00856 Drugs Product Database (DPD):2091496 KEGG COMPOUND:C07928 PharmGKB:PA164784022 PubChem Substance:46504714 |
|
| subClassOf |