loading...| Preferred Name |
edrophonium |
|
| Synonyms |
N-ethyl-3-hydroxy-N,N-dimethylbenzenaminium Edrophonium Ethyl-(3-hydroxy-phenyl)-dimethyl-ammonium N-ethyl-3-hydroxy-N,N-dimethylanilinium C10H16NO EDROPHONIUM ION edrophonium (3-hydroxyphenyl)dimethylethylammonium EDROPHONIUM 3-hydroxy-N,N-dimethyl-N-ethylanilinium |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_251408 |
|
| AHFScode |
36:56.00 |
|
| altId |
CHEBI:42376 CHEBI:4758 |
|
| CASRN |
116-38-1 |
|
| DBBrand |
enlon plus reversol tensilon tensilon chloride antirex enlon |
|
| DBname |
edrophonium |
|
| DBSynonym |
edrophone chloride edrophonum edr edrophonium ion edrophonium chloride |
|
| Definition |
N-Ethyl-N,N-dimethylanilinium in which on of the meta positions is substituted by a hydroxy group. It is a reversible inhibitor of cholinesterase, with a rapid onset (30-60 seconds after injection) but a short duration of action (5-15 minutes). The chloride salt is used in myasthenia gravis both diagnostically and to distinguish between under- or over-treatment with other anticholinesterases. It has also been used for the reversal of neuromuscular blockade in anaesthesia, and for the management of poisoning due to tetrodotoxin, a neuromuscular blocking toxin found in puffer fish and other marine animals. |
|
| has pharmacological target | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_50247 |
|
| InChI |
InChI=1S/C10H15NO/c1-4-11(2,3)9-6-5-7-10(12)8-9/h5-8H,4H2,1-3H3/p+1 |
|
| InChIKey |
InChIKey=VWLHWLSRQJQWRG-UHFFFAOYSA-O |
|
| inhibits | ||
| label |
edrophonium |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_41879 http://purl.obolibrary.org/obo/CHEBI_3077 http://purl.obolibrary.org/obo/CHEBI_8382 http://purl.obolibrary.org/obo/CHEBI_17650 http://purl.obolibrary.org/obo/CHEBI_50885 http://purl.obolibrary.org/obo/dinto_DB00382 |
|
| prefixIRI |
obo2:CHEBI_251408 |
|
| prefLabel |
edrophonium |
|
| SMILES |
CC[N+](C)(C)c1cccc(O)c1 CC[N+](C)(C)C1=CC(O)=CC=C1 |
|
| Synonym |
N-ethyl-3-hydroxy-N,N-dimethylbenzenaminium Edrophonium Ethyl-(3-hydroxy-phenyl)-dimethyl-ammonium N-ethyl-3-hydroxy-N,N-dimethylanilinium C10H16NO EDROPHONIUM ION edrophonium (3-hydroxyphenyl)dimethylethylammonium EDROPHONIUM 3-hydroxy-N,N-dimethyl-N-ethylanilinium |
|
| xref |
CASRN:312-48-1 CiteXplore:7488499 PDB:EDR Wikipedia:http://en.wikipedia.org/wiki/Edrophonium PharmGKB:PA449437 ChemSpider:3090 PDBeChem:EDR Drugs.com:http://www.drugs.com/mtm/edrophonium.html Beilstein:3905622 DrugBank:DB01010 PubChem Compound:3202 KEGG COMPOUND:C06976 RxList:http://www.rxlist.com/cgi/generic3/edrophonium.htm National Drug Code Directory:10019-873-15 ChEBI:251408 PubChem Substance:46507530 Drugs Product Database (DPD):2188848 |
|
| subClassOf |