loading...| Preferred Name |
benzocaine |
|
| Synonyms |
p-Ethoxycarboxylic aniline Benzocaina p-Carbethoxyaniline ethyl 4-aminobenzoate Benzocaine 4-aminobenzoic acid ethyl ester Ethyl p-aminobenzoate p-(Ethoxycarbonyl)aniline Amben ethyl ester Ethyl p-aminophenylcarboxylate Benzocainum Ethyl aminobenzoate C9H11NO2 |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_116735 |
|
| AHFScode |
52:16.00 84:08.00 |
|
| altId |
CHEBI:3030 |
|
| ATCCode |
D04AB04 R02AD01 C05AD03 N01BA05 A01AD11 |
|
| CASRN |
94-09-7 |
|
| DBBrand |
ora-jel identhesin hurricaine orthesin amben ethyl ester anestezin aethoform anaesthesin norcaine norcain solu h anesthesin anesthesine keloform baby anbesol dermoplast parathesine ethoform parathesin americaine anaesthin anaesthan-syngala anesthone topcaine |
|
| DBname |
benzocaine |
|
| DBSynonym |
p-carbethoxyaniline ethylester kyseliny p-aminobenzoove p-ethoxycarboxylic aniline ethyl aminobenzoate ethyl p-aminophenylcarboxylate p-aminobenzoic acid, ethyl ester ethyl p-aminobenzoate |
|
| Definition |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000376 http://purl.obolibrary.org/obo/OAE_0000549 http://purl.obolibrary.org/obo/OAE_0000086 http://purl.obolibrary.org/obo/OAE_0000645 http://purl.obolibrary.org/obo/OAE_0000584 |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
|
| InChIKey |
InChIKey=BLFLLBZGZJTVJG-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_2913 |
|
| label |
benzocaine |
|
| prefixIRI |
obo2:CHEBI_116735 |
|
| prefLabel |
benzocaine |
|
| SMILES |
CCOC(=O)c1ccc(N)cc1 CCOC(=O)C1=CC=C(N)C=C1 |
|
| Synonym |
p-Ethoxycarboxylic aniline Benzocaina p-Carbethoxyaniline ethyl 4-aminobenzoate Benzocaine 4-aminobenzoic acid ethyl ester Ethyl p-aminobenzoate p-(Ethoxycarbonyl)aniline Amben ethyl ester Ethyl p-aminophenylcarboxylate Benzocainum Ethyl aminobenzoate C9H11NO2 |
|
| xref |
ChemSpider:13854242 CiteXplore:21616561 CiteXplore:1155304 CiteXplore:18971079 PubChem Substance:46508891 Wikipedia:http://en.wikipedia.org/wiki/Benzocaine KEGG COMPOUND:C07527 KEGG DRUG:D00552 CiteXplore:22556388 Beilstein:638434 RxList:http://www.rxlist.com/cgi/generic3/americaine.htm Drugs.com:http://www.drugs.com/cdi/benzocaine-drops.html CiteXplore:23565580 ChEBI:116735 CiteXplore:23696166 ChEMBL:2579237 PharmGKB:PA448576 DrugBank:DB01086 CiteXplore:12574744 NIST Chemistry WebBook:94-09-7 CiteXplore:22105694 ChEMBL:10866370 CiteXplore:22551703 CiteXplore:22015737 CiteXplore:16640711 CASRN:94-09-7 Drugs Product Database (DPD):2223805 CiteXplore:23301559 ChEMBL:12873507 PubChem Compound:2337 Wikipedia:Benzocaine |
|
| subClassOf |