loading...| Preferred Name |
aclidinium |
|
| Synonyms |
C26H30BrNO4S2 3-{[2-hydroxy-2,2-bis(thiophen-2-yl)acetyl]oxy}-1-(3-phenoxypropyl)-1-azabicyclo[2.2.2]octan-1-ium bromide |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08897 |
|
| AHFScode |
12:08.08 |
|
| ATCCode |
R03BB05 |
|
| blocks |
http://purl.obolibrary.org/obo/dinto_3182 http://purl.obolibrary.org/obo/dinto_1005 http://purl.obolibrary.org/obo/dinto_0703 |
|
| CASRN |
320345-99-1 |
|
| DBBrand |
tudorza pressair eklira genuair bretaris genuair |
|
| DBSalt |
aclidinium bromide |
|
| DBSynonym |
14115700 las-34273 micronized las-34273 las-w-330 |
|
| Definition |
Aclidinium is an anticholinergic for the long-term management of chronic obstructive pulmonary disease (COPD). It has a much higher propensity to bind to muscarinic receptors than nicotinic receptors. FDA approved on July 24, 2012. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_3182 http://purl.obolibrary.org/obo/dinto_1005 http://purl.obolibrary.org/obo/dinto_0703 |
|
| InChI |
InChI=1/C26H30NO4S2.BrH/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2;1H/q+1;/p-1 |
|
| InChIKey |
InChIKey=XLAKJQPTOJHYDR-UHFFFAOYNA-M |
|
| is metabolised by | ||
| label |
aclidinium |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB08897 |
|
| prefLabel |
aclidinium |
|
| SMILES |
[Br-].OC(C(=O)OC1C[N+]2(CCCOC3=CC=CC=C3)CCC1CC2)(C1=CC=CS1)C1=CC=CS1 |
|
| Synonym |
C26H30BrNO4S2 3-{[2-hydroxy-2,2-bis(thiophen-2-yl)acetyl]oxy}-1-(3-phenoxypropyl)-1-azabicyclo[2.2.2]octan-1-ium bromide |
|
| xref |
RxList:http://www.rxlist.com/tudorza-pressair-drug.htm Drugs.com:http://www.drugs.com/tudorza.html ChEBI:65344 National Drug Code Directory:0456-0800-60 |
|
| subClassOf |