loading...| Preferred Name |
hydroxyproline |
|
| Synonyms |
(4S)-4-hydroxypyrrolidine-2-carboxylic acid C5H9NO3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08847 |
|
| CASRN |
51-35-4 |
|
| DBSynonym |
l-hydroxyproline trans-4-hydroxy-l-proline |
|
| Definition |
Hydroxyproline is a neutral heterocyclic protein amino acid. It is found in collagen and as such it is common in many gelatin products. Hydroxyproline is mostly used as a diagnostic marker of bone turnover and liver fibrosis. Therapeutically, hydroxyproline is being studied as an an experimental medicine but is approved in France as a combination topical gel product called Cicactive for small, superficial wounds. |
|
| InChI |
InChI=1/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4?/s2 |
|
| InChIKey |
InChIKey=PMMYEEVYMWASQN-ACHLYQRRNA-N |
|
| label |
hydroxyproline |
|
| prefixIRI |
obo2:dinto_DB08847 |
|
| prefLabel |
hydroxyproline |
|
| related with | ||
| SMILES |
O[C@@H]1CNC(C1)C(O)=O |
|
| Synonym |
(4S)-4-hydroxypyrrolidine-2-carboxylic acid C5H9NO3 |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Hydroxyproline ChEBI:18095 |
|
| subClassOf |