loading...| Preferred Name |
cinitapride |
|
| Synonyms |
4-amino-N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-ethoxy-5-nitrobenzamide C21H30N4O4 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08810 |
|
| activates | ||
| binds |
http://purl.obolibrary.org/obo/dinto_1166 |
|
| blocks | ||
| CASRN |
66564-14-5 |
|
| DBBrand |
cintapro cinmove paxapride pemix blaston cidine |
|
| Definition |
Cinitapride is a gastroprokinetic agent and antiulcer agent of the benzamide class which is marketed in Spain and Mexico. It acts as an agonist of the 5-HT1 and 5-HT4 receptors and as an antagonist of the 5-HT2 receptors. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C21H30N4O4/c1-2-29-20-13-18(22)19(25(27)28)12-17(20)21(26)23-16-8-10-24(11-9-16)14-15-6-4-3-5-7-15/h3-4,12-13,15-16H,2,5-11,14,22H2,1H3,(H,23,26) |
|
| InChIKey |
InChIKey=ZDLBNXXKDMLZMF-UHFFFAOYSA-N |
|
| label |
cinitapride |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_4551 http://purl.obolibrary.org/obo/CHEBI_16794 http://purl.obolibrary.org/obo/dinto_DB00462 |
|
| modulates |
http://purl.obolibrary.org/obo/dinto_0392 |
|
| prefixIRI |
obo2:dinto_DB08810 |
|
| prefLabel |
cinitapride |
|
| SMILES |
CCOC1=CC(N)=C(C=C1C(=O)NC1CCN(CC2CCC=CC2)CC1)[N+]([O-])=O |
|
| Synonym |
4-amino-N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-ethoxy-5-nitrobenzamide C21H30N4O4 |
|
| xref |
PharmGKB:PA165958427 Wikipedia:http://en.wikipedia.org/wiki/Cinitapride |
|
| subClassOf |