loading...| Preferred Name |
tolrestat |
|
| Synonyms |
2-{1-[6-methoxy-5-(trifluoromethyl)naphthalen-1-yl]-N-methylmethanethioamido}acetic acid C16H14F3NO3S |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB02383 |
|
| ATCCode |
A10XA01 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_2716 |
|
| CASRN |
82964-04-3 |
|
| DBBrand |
alredase |
|
| Definition |
Tolrestat (INN) (AY-27773) is an aldose reductase inhibitor which was approved for the control of certain diabetic complications. While it was approved for marketed in several countries, it failed a Phase III trial in the U.S. due to toxicity and never received FDA approval. It was discontinued by Wyeth in 1997 because of the risk of severe liver toxicity and death. It was sold under the tradename Alredase. [Wikipedia] |
|
| InChI |
InChI=1S/C16H14F3NO3S/c1-20(8-13(21)22)15(24)11-5-3-4-10-9(11)6-7-12(23-2)14(10)16(17,18)19/h3-7H,8H2,1-2H3,(H,21,22) |
|
| InChIKey |
InChIKey=LUBHDINQXIHVLS-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
tolrestat |
|
| prefixIRI |
obo2:dinto_DB02383 |
|
| prefLabel |
tolrestat |
|
| related with | ||
| SMILES |
COC1=C(C2=CC=CC(C(=S)N(C)CC(O)=O)=C2C=C1)C(F)(F)F |
|
| Synonym |
2-{1-[6-methoxy-5-(trifluoromethyl)naphthalen-1-yl]-N-methylmethanethioamido}acetic acid C16H14F3NO3S |
|
| xref |
BindingDB:16314 Wikipedia:http://en.wikipedia.org/wiki/Tolrestat PDB:TOL ChemSpider:48194 PubChem Compound:53359 ChEBI:48549 PubChem Substance:46508274 |
|
| subClassOf |