loading...| Preferred Name |
iophendylate |
|
| Synonyms |
C19H29IO2 ethyl 10-(2-iodophenyl)undecanoate |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01187 |
|
| CASRN |
99-79-6 |
|
| DBBrand |
pantopaque |
|
| Definition |
Iophendylate is a mixture of isomers used as contrast medium, mainly for brain and spinal cord visualization. Iophendylate is a myelographic oil-ester (U.S. Patent 2,348,231). Iophendylate, which was never shown to be safe, was initially introduced for use in small amounts (1-2cc) for locating spinal tumors. It next appeared on the world scene for high volume (12-15cc), routine use, in diagnosing disc herniations. A number of clinicians have published on the dangers of oil myelography. In 1942 Van Wagenen (a neurosurgical colleague of Warrens, at the University of Rochester) identified Iophendylate as causing chemical meningitis in 30 patients where "space-displacing masses within the spinal canal were suspected". |
|
| InChI |
InChI=1S/C19H29IO2/c1-3-22-19(21)15-9-7-5-4-6-8-12-16(2)17-13-10-11-14-18(17)20/h10-11,13-14,16H,3-9,12,15H2,1-2H3 |
|
| InChIKey |
InChIKey=IWRUDYQZPTVTPA-UHFFFAOYSA-N |
|
| label |
iophendylate |
|
| prefixIRI |
obo2:dinto_DB01187 |
|
| prefLabel |
iophendylate |
|
| SMILES |
CCOC(=O)CCCCCCCCC(C)C1=CC=CC=C1I |
|
| Synonym |
C19H29IO2 ethyl 10-(2-iodophenyl)undecanoate |
|
| xref |
PubChem Compound:3037234 PubChem Substance:46508391 PharmGKB:PA164743143 ChemSpider:2301035 |
|
| subClassOf |