loading...| Preferred Name |
phenacemide |
|
| Synonyms |
C9H10N2O2 (2-phenylacetyl)urea |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01121 |
|
| ATCCode |
N03AX07 |
|
| binds | ||
| CASRN |
63-98-9 |
|
| DBBrand |
phenutal neophenal fenacemide phenyrit phenarone fenised phetylureum comitiadone epheron phenurone efron fenylacetylmocovina fenilep neophedan phenuron fenural cetylureum carbanmide fenacetamide phenacetur eferon fenacetil-karbamide fenostenyl fenurea fenytan phacetur phenacalum acetylureum fenacemid phenacereum fenurone phenicarb felurea epiclase |
|
| DBSynonym |
phenylacetyluree phenacetylurea carbamide phenylacetate phenylacetylurea phenacetylcarbamide |
|
| Definition |
Phenacemide is used to control certain seizures in the treatment of epilepsy. This medicine acts on the central nervous system (CNS) to reduce the number and severity of seizures. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C9H10N2O2/c10-9(13)11-8(12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12,13) |
|
| InChIKey |
InChIKey=XPFRXWCVYUEORT-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
phenacemide |
|
| prefixIRI |
obo2:dinto_DB01121 |
|
| prefLabel |
phenacemide |
|
| SMILES |
NC(=O)NC(=O)CC1=CC=CC=C1 |
|
| Synonym |
C9H10N2O2 (2-phenylacetyl)urea |
|
| xref |
PharmGKB:PA164745309 Wikipedia:http://en.wikipedia.org/wiki/Phenacemide PubChem Substance:46508400 ChemSpider:4589 PubChem Compound:4753 |
|
| subClassOf |