loading...| Preferred Name |
metyrapone |
|
| Synonyms |
2-methyl-1,2-bis(pyridin-3-yl)propan-1-one C14H14N2O |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01011 |
|
| ATCCode |
V04CD01 |
|
| CASRN |
54-36-4 |
|
| DBBrand |
metapirone metopirone metapyron metopyrone metopiron |
|
| DBSynonym |
methopyrapone methopyrone methapyrapone methbipyranone metroprione metyrapon mepyrapone methopyrinine methopirapone |
|
| Definition |
An inhibitor of the enzyme steroid 11-beta-monooxygenase. It is used as a test of the feedback hypothalamic-pituitary mechanism in the diagnosis of cushing syndrome. [PubChem] |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000388 http://purl.obolibrary.org/obo/OAE_0000081 http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0000600 http://purl.obolibrary.org/obo/OAE_0000601 http://purl.obolibrary.org/obo/OAE_0000551 http://purl.obolibrary.org/obo/OAE_0000752 http://purl.obolibrary.org/obo/OAE_0000362 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C14H14N2O/c1-14(2,12-6-4-8-16-10-12)13(17)11-5-3-7-15-9-11/h3-10H,1-2H3 |
|
| InChIKey |
InChIKey=FJLBFSROUSIWMA-UHFFFAOYSA-N |
|
| induces | ||
| inhibits |
http://purl.obolibrary.org/obo/dinto_2667 http://purl.obolibrary.org/obo/dinto_0293 http://purl.obolibrary.org/obo/dinto_0901 |
|
| label |
metyrapone |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_8107 |
|
| prefixIRI |
obo2:dinto_DB01011 |
|
| prefLabel |
metyrapone |
|
| related with | ||
| SMILES |
CC(C)(C(=O)C1=CN=CC=C1)C1=CN=CC=C1 |
|
| Synonym |
2-methyl-1,2-bis(pyridin-3-yl)propan-1-one C14H14N2O |
|
| xref |
ChEBI:6911 PubChem Compound:4174 PharmGKB:PA450486 Wikipedia:http://en.wikipedia.org/wiki/Metyrapone Drugs.com:http://www.drugs.com/cdi/metyrapone.html ChemSpider:4030 RxList:http://www.rxlist.com/cgi/generic3/metopirone.htm PubChem Substance:46504862 PDB:MYT National Drug Code Directory:0078-0455-17 |
|
| subClassOf |