loading...| Preferred Name |
phensuximide |
|
| Synonyms |
1-methyl-3-phenylpyrrolidine-2,5-dione C11H11NO2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00832 |
|
| ATCCode |
N03AD02 |
|
| binds | ||
| CASRN |
86-34-0 |
|
| DBBrand |
milontin 1-methyl-3-phenylsuccinimide milonton n-methyl-alpha-phenolsuccinimide phenylsuximide milontin (tn) phensuximide [ban:inn] methylphenylsuccinimide phensuximid lifene epimid mirontin succinimide, n-methyl-2-phenyl- fenosuccimide fensuximida [inn-spanish] fensuccimide [dcit] succitimal phensuximidum [inn-latin] n-methyl-2-phenylsuccinimide phensuximide (usp) n-methyl-alpha-phenylsuccinimide (+/-)-n-methyl-2-phenylsuccinimide mirotin;7 phenosuccimide |
|
| Definition |
Phensuximide is an anticonvulsant in the succinimide class. It suppresses the paroxysmal three cycle per second spike and wave EEG pattern associated with lapses of consciousness in petit mal seizures. The frequency of attacks is reduced by depression of nerve transmission in the motor cortex. |
|
| InChI |
InChI=1S/C11H11NO2/c1-12-10(13)7-9(11(12)14)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
|
| InChIKey |
InChIKey=WLWFNJKHKGIJNW-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
phensuximide |
|
| prefixIRI |
obo2:dinto_DB00832 |
|
| prefLabel |
phensuximide |
|
| SMILES |
CN1C(=O)CC(C1=O)C1=CC=CC=C1 |
|
| Synonym |
1-methyl-3-phenylpyrrolidine-2,5-dione C11H11NO2 |
|
| xref |
PubChem Compound:6839 PharmGKB:PA164771230 Wikipedia:http://en.wikipedia.org/wiki/Phensuximide ChemSpider:6578 PubChem Substance:46505695 |
|
| subClassOf |