Preferred Name |
metaxalone |
|
Synonyms |
C12H15NO3 5-(3,5-dimethylphenoxymethyl)-1,3-oxazolidin-2-one |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB00660 |
|
CASRN |
1665-48-1 |
|
DBBrand |
zorane skelaxin |
|
DBSynonym |
metazolone metaxalon metaxalonum [inn-latin] metaxalonum [latin] metaxalona [inn-spanish] metassalone [dcit] methaxalonum metazalone methoxolone |
|
Definition |
Metaxalone (marketed by King Pharmaceuticals under the brand name Skelaxin?) is a muscle relaxant used to relax muscles and relieve pain caused by strains, sprains, and other musculoskeletal conditions. Its exact mechanism of action is not known, but it may be due to general central nervous system depression. It is considered to be a moderately strong muscle relaxant, with relatively low incidence of side effects. Skelaxin comes in an 800 mg scored tablet. It previously came in both 400 mg and 800 mg tablets. The 400 mg tablet has been discontinued. Possible side effects include nausea, vomiting, drowsiness and CNS side effects such as dizziness, headache, and irritability. |
|
InChI |
InChI=1S/C12H15NO3/c1-8-3-9(2)5-10(4-8)15-7-11-6-13-12(14)16-11/h3-5,11H,6-7H2,1-2H3,(H,13,14) |
|
InChIKey |
InChIKey=IMWZZHHPURKASS-UHFFFAOYSA-N |
|
label |
metaxalone |
|
may interact with | ||
prefixIRI |
obo2:dinto_DB00660 |
|
prefLabel |
metaxalone |
|
SMILES |
CC1=CC(OCC2CNC(=O)O2)=CC(C)=C1 |
|
Synonym |
C12H15NO3 5-(3,5-dimethylphenoxymethyl)-1,3-oxazolidin-2-one |
|
xref |
PubChem Compound:15459 ChemSpider:14709 PharmGKB:PA164747189 PubChem Substance:46506253 Drugs.com:http://www.drugs.com/cdi/metaxalone.html Wikipedia:http://en.wikipedia.org/wiki/Metaxalone RxList:http://www.rxlist.com/cgi/generic/metax.htm National Drug Code Directory:0185-0448-01 |
|
subClassOf |