loading...| Preferred Name |
hexylcaine |
|
| Synonyms |
C16H23NO2 1-(cyclohexylamino)propan-2-yl benzoate |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00473 |
|
| CASRN |
532-77-4 |
|
| DBBrand |
hexylcainum [inn-latin] osmocaine hexylcaine hydrochloride hexilcaina [inn-spanish] cyclaine |
|
| Definition |
Hexylcaine hydrochloride, also called cyclaine (Merck) or osmocaine, is a short-acting local anesthetic. It acts by inhibiting sodium channel conduction. Overdose can lead to headache, tinnitus, numbness and tingling around the mouth and tongue, convulsions, inability to breathe, and decreased heart function. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
|
| InChIKey |
InChIKey=DKLKMKYDWHYZTD-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
hexylcaine |
|
| prefixIRI |
obo2:dinto_DB00473 |
|
| prefLabel |
hexylcaine |
|
| SMILES |
CC(CNC1CCCCC1)OC(=O)C1=CC=CC=C1 |
|
| Synonym |
C16H23NO2 1-(cyclohexylamino)propan-2-yl benzoate |
|
| xref |
PharmGKB:PA164746489 PubChem Substance:46506241 PubChem Compound:10770 ChemSpider:10315 BindingDB:50017670 Wikipedia:http://en.wikipedia.org/wiki/Hexylcaine |
|
| subClassOf |