loading...| Preferred Name |
dydrogesterone |
|
| Synonyms |
C21H28O2 (1R,2S,10S,11S,14S,15S)-14-acetyl-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-6,8-dien-5-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00378 |
|
| activates | ||
| ATCCode |
G03DB01 |
|
| CASRN |
152-62-5 |
|
| DBBrand |
prodel terolut dufaston gynorest duvaron retrone gestatron diphaston duphaston |
|
| DBSynonym |
isopregnenone hydrogesterone didrogesterone [dcit] dydrogesteronum [inn-latin] 10alpha-isopregnenone dydrogesterona [inn-spanish] hydrogestrone |
|
| Definition |
A synthetic progestational hormone with no androgenic or estrogenic properties. Unlike many other progestational compounds, dydrogesterone produces no increase in temperature and does not inhibit ovulation. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C21H28O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12,16-19H,6-11H2,1-3H3/t16-,17+,18-,19+,20+,21+/m0/s1 |
|
| InChIKey |
InChIKey=JGMOKGBVKVMRFX-HQZYFCCVSA-N |
|
| label |
dydrogesterone |
|
| prefixIRI |
obo2:dinto_DB00378 |
|
| prefLabel |
dydrogesterone |
|
| SMILES |
[H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@]1([H])[C@@]2([H])C=CC2=CC(=O)CC[C@@]12C |
|
| Synonym |
C21H28O2 (1R,2S,10S,11S,14S,15S)-14-acetyl-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-6,8-dien-5-one |
|
| xref |
ChemSpider:8699 ChEBI:31527 Wikipedia:http://en.wikipedia.org/wiki/Dydrogesterone PubChem Substance:46506195 PubChem Compound:9051 PharmGKB:PA164745443 IUPHAR:2878 Guide To Pharmacology:2878 |
|
| subClassOf |