loading...| Preferred Name |
dimethyl fumarate |
|
| Synonyms |
trans-Butenedioic acid dimethyl ester C6H8O4 trans-1,2-Ethylenedicarboxylic acid dimethyl ester Tecfidera Fumaric acid, dimethyl ester dimethyl (2E)-but-2-enedioate 1,2-bis(methoxycarbonyl)-trans-ethylene (E)-But-2-enedioic acid dimethyl ester Dimethyl trans-ethylenedicarboxylate |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_76004 |
|
| binds | ||
| CASRN |
624-49-7 |
|
| DBBrand |
tecfidera |
|
| DBname |
dimethyl fumarate |
|
| DBSynonym |
dimethyl (e) butenedioate bg-12 |
|
| Definition |
An enoate ester resulting from the formal condensation of both carboxy groups of fumaric acid with methanol. Used for treatment of adults with relapsing forms of multiple sclerosis. |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3+ |
|
| InChIKey |
InChIKey=LDCRTTXIJACKKU-ONEGZZNKSA-N |
|
| label |
dimethyl fumarate |
|
| prefixIRI |
obo2:CHEBI_76004 |
|
| prefLabel |
dimethyl fumarate |
|
| SMILES |
COC(=O)\\C=C\\C(=O)OC |
|
| Synonym |
trans-Butenedioic acid dimethyl ester C6H8O4 trans-1,2-Ethylenedicarboxylic acid dimethyl ester Tecfidera Fumaric acid, dimethyl ester dimethyl (2E)-but-2-enedioate 1,2-bis(methoxycarbonyl)-trans-ethylene (E)-But-2-enedioic acid dimethyl ester Dimethyl trans-ethylenedicarboxylate |
|
| xref |
National Drug Code Directory:64406-006-02 ChEMBL:1479603 CiteXplore:24061646 Wikipedia:Dimethyl_fumarate Drugs.com:http://www.drugs.com/cdi/dimethyl-fumarate.html Patent:US2008089861 HMDB:HMDB31257 KEGG DRUG:D03846 NIST Chemistry WebBook:624-49-7 RxList:http://www.rxlist.com/tecfidera-drug.htm Reaxys:774590 CiteXplore:23946617 Wikipedia:http://en.wikipedia.org/wiki/Dimethyl_fumarate Patent:WO2011100589 CASRN:624-49-7 DrugBank:DB08908 |
|
| subClassOf |