loading...| Preferred Name |
azaserine |
|
| Synonyms |
azaserine C5H7N3O4 L-serine diazoacetate ester O-(diazoacetyl)-L-serine L-beta-(diazoacetoxy)alanine L-beta-(diazoacetoxy)alanin L-azaserine L-serine diazoacetate azaserina azaserinum |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74846 |
|
| Definition |
A carboxylic ester resulting from the formal condensation of the carboxy group of diazoacetic acid with the alcoholic hydroxy group of L-serine. An antibiotic produced by a Streptomyces species. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_22582 http://purl.obolibrary.org/obo/CHEBI_26619 |
|
| InChI |
InChI=1S/C5H7N3O4/c6-3(5(10)11)2-12-4(9)1-8-7/h1,3H,2,6H2,(H,10,11)/t3-/m0/s1 |
|
| InChIKey |
InChIKey=MZZGOOYMKKIOOX-VKHMYHEASA-N |
|
| label |
azaserine |
|
| prefixIRI |
obo2:CHEBI_74846 |
|
| prefLabel |
azaserine |
|
| SMILES |
N[C@@H](COC(=O)C=[N+]=[N-])C(O)=O |
|
| Synonym |
azaserine C5H7N3O4 L-serine diazoacetate ester O-(diazoacetyl)-L-serine L-beta-(diazoacetoxy)alanine L-beta-(diazoacetoxy)alanin L-azaserine L-serine diazoacetate azaserina azaserinum |
|
| xref |
ChEMBL:730052 MetaCyc:L-AZASERINE Patent:US2996435 CiteXplore:7048085 PDBeChem:AZS CiteXplore:23301939 KEGG COMPOUND:C19194 Wikipedia:Azaserine KEGG DRUG:D03032 CiteXplore:4951003 CiteXplore:19136606 CiteXplore:791808 CiteXplore:23101568 CASRN:115-02-6 Patent:US3030388 |
|
| subClassOf |