loading...| Preferred Name |
monothioglycerol |
|
| Synonyms |
1-mercaptoglycerol alpha-thiolglycerol 1-thio-2,3-propanediol monothioglycerol 1-mercapto-2,3-propanediol C3H8O2S thioglycerin 1-thioglycerol 3-mercapto-1,2-propanediol monothioglycerin 3-mercaptopropane-1,2-diol 3-sulfanylpropane-1,2-diol 1-monothioglycerol 2,3-dihydroxypropanethiol (2R)-3-sulfanylpropane-1,2-diol thioglycerol thioglycerine |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74537 |
|
| binds | ||
| Definition |
A thiol that is glycerol in which one of the primary hydroxy groups is replaced by a thiol group. |
|
| has role | ||
| InChI |
InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2/t3-/m1/s1 InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2 |
|
| InChIKey |
InChIKey=PJUIMOJAAPLTRJ-GSVOUGTGSA-N InChIKey=PJUIMOJAAPLTRJ-UHFFFAOYSA-N |
|
| label |
monothioglycerol |
|
| prefixIRI |
obo2:CHEBI_74537 |
|
| prefLabel |
monothioglycerol |
|
| related with | ||
| SMILES |
OCC(O)CS OC[C@@H](O)CS |
|
| Synonym |
1-mercaptoglycerol alpha-thiolglycerol 1-thio-2,3-propanediol monothioglycerol 1-mercapto-2,3-propanediol C3H8O2S thioglycerin 1-thioglycerol 3-mercapto-1,2-propanediol monothioglycerin 3-mercaptopropane-1,2-diol 3-sulfanylpropane-1,2-diol 1-monothioglycerol 2,3-dihydroxypropanethiol (2R)-3-sulfanylpropane-1,2-diol thioglycerol thioglycerine |
|
| xref |
CiteXplore:6166247 Reaxys:1732046 PubChem Compound:447638 Wikipedia:3-Mercaptopropane-1,2-diol CiteXplore:6362560 CiteXplore:922117 PubChem Substance:46508507 MetaCyc:CPD0-1951 CiteXplore:6362561 NIST Chemistry WebBook:96-27-5 CiteXplore:18586770 ChEMBL:922832 KEGG DRUG:D05075 PDB:SGM CASRN:96-27-5 |
|
| subClassOf |