Preferred Name |
erythrityl tetranitrate |
|
Synonyms |
erythrol tetranitrate tetranitrate d'eritrityle 1,2,3,4-butanetetralyl tetranitrate tetranitrato de eritritilo (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate eritrityl tetranitrate (2S,3R)-2,3,4-tris(nitrooxy)butyl nitrate tetranitrol erythritol tetranitrate meso-erythritol tetranitrate ETN (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate C4H6N4O12 tetranitrin eritrityli tetranitras |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_60072 |
|
activates | ||
ATCCode |
C01DA13 |
|
CASRN |
7297-25-8 |
|
DBBrand |
cardiwell tetranitrol cardiloid cardivell cardilate tetranitrin |
|
DBname |
erythrityl tetranitrate |
|
DBSynonym |
erythrol tetranitrate tetranitrate d'eritrityle [inn-french] 1,2,3,4-butanetetralyl tetranitrate etn eritrityl tetranitrate tetranitrato de eritritilo [inn-spanish] nitroerythrol nitroerythrit erythritol tetranitrate eritrityli tetranitras [inn-latin] meso-erythritol tetranitrate nitroerythrite eritritile tetranitrato [dcit] |
|
Definition |
Erythritol in which each of the hydroxy groups has been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to nitroglycerin. It is usually used diluted with lactose or other suitable inert excipients, in order to minimise the risk of explosion; undiluted erythrityl tetranitrate can be exploded by percussion or excessive heat. |
|
has pharmacological target | ||
has role | ||
InChI |
InChI=1S/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
|
InChIKey |
InChIKey=SNFOERUNNSHUGP-ZXZARUISSA-N |
|
label |
erythrityl tetranitrate |
|
may interact with |
http://purl.obolibrary.org/obo/CHEBI_584020 |
|
prefixIRI |
obo2:CHEBI_60072 |
|
prefLabel |
erythrityl tetranitrate |
|
SMILES |
[O-][N+](=O)OC[C@@H](O[N+]([O-])=O)[C@H](CO[N+]([O-])=O)O[N+]([O-])=O |
|
Synonym |
erythrol tetranitrate tetranitrate d'eritrityle 1,2,3,4-butanetetralyl tetranitrate tetranitrato de eritritilo (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate eritrityl tetranitrate (2S,3R)-2,3,4-tris(nitrooxy)butyl nitrate tetranitrol erythritol tetranitrate meso-erythritol tetranitrate ETN (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate C4H6N4O12 tetranitrin eritrityli tetranitras |
|
xref |
PharmGKB:PA164746528 DrugBank:DB01613 Beilstein:1730082 CASRN:7297-25-8 ChEMBL:1479853 Wikipedia:Erythritol_tetranitrate KEGG DRUG:D04051 ChEBI:60072 |
|
subClassOf |