Preferred Name |
amylmetacresol |
|
Synonyms |
6-amyl-m-cresol 6-n-pentyl-m-cresol 5-methyl-2-pentylphenol C12H18O 6-n-amyl-m-cresol Amylmetacresol 6-pentyl-m-cresol amylmetacresolum |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_48213 |
|
Definition |
A phenol having the structure of m-cresol substituted at the 6-position with an amyl group. |
|
has role | ||
InChI |
InChI=1S/C12H18O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13/h7-9,13H,3-6H2,1-2H3 |
|
InChIKey |
InChIKey=CKGWFZQGEQJZIL-UHFFFAOYSA-N |
|
label |
amylmetacresol |
|
prefixIRI |
obo2:CHEBI_48213 |
|
prefLabel |
amylmetacresol |
|
SMILES |
CCCCCc1ccc(C)cc1O |
|
Synonym |
6-amyl-m-cresol 6-n-pentyl-m-cresol 5-methyl-2-pentylphenol C12H18O 6-n-amyl-m-cresol Amylmetacresol 6-pentyl-m-cresol amylmetacresolum |
|
xref |
Beilstein:2440952 ChEMBL:1036561 CASRN:1300-94-3 |
|
subClassOf |
Create mapping