loading...| Preferred Name |
L-threonine |
|
| Synonyms |
L-Threonine (2S,3R)-2-amino-3-hydroxybutanoic acid THREONINE L-(-)-Threonine L-threonine (2S)-threonine C4H9NO3 L-2-Amino-3-hydroxybutyric acid L-alpha-amino-beta-hydroxybutyric acid T Thr (2S,3R)-(-)-Threonine L-Threonin 2-Amino-3-hydroxybutyric acid |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16857 |
|
| altId |
CHEBI:13175 CHEBI:42083 CHEBI:6308 CHEBI:45843 CHEBI:45983 CHEBI:21403 |
|
| CASRN |
72-19-5 |
|
| DBname |
l-threonine |
|
| DBSynonym |
threonine 2-amino-3-hydroxybutyric acid threonin [r-(r*,s*)]-2-amino-3-hydroxybutanoic acid l-(-)-threonine (s)-threonine |
|
| Definition |
An optically active form of threonine having L-configuration. |
|
| has role | ||
| InChI |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 |
|
| InChIKey |
InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N |
|
| inhibits | ||
| label |
L-threonine |
|
| prefixIRI |
obo2:CHEBI_16857 |
|
| prefLabel |
L-threonine |
|
| related with |
http://purl.obolibrary.org/obo/dinto_0025 |
|
| SMILES |
C[C@@H](O)[C@H](N)C(O)=O |
|
| Synonym |
L-Threonine (2S,3R)-2-amino-3-hydroxybutanoic acid THREONINE L-(-)-Threonine L-threonine (2S)-threonine C4H9NO3 L-2-Amino-3-hydroxybutyric acid L-alpha-amino-beta-hydroxybutyric acid T Thr (2S,3R)-(-)-Threonine L-Threonin 2-Amino-3-hydroxybutyric acid |
|
| xref |
NIST Chemistry WebBook:72-19-5 CASRN:72-19-5 DrugBank:DB00156 ChEMBL:190815 Wikipedia:http://en.wikipedia.org/wiki/L-Threonine Wikipedia:Threonine PubChem Substance:46506798 CiteXplore:22342587 PharmGKB:PA451673 CiteXplore:16659349 UM-BBD:c0413 CiteXplore:22513921 Reaxys:1721646 PDB:THR Gmelin:82510 HMDB:HMDB00167 CiteXplore:22770225 CiteXplore:12523390 Beilstein:1721646 CiteXplore:17379183 ChemSpider:6051 KEGG COMPOUND:C00188 PubChem Compound:6288 ChEBI:16857 KEGG DRUG:D00041 PDBeChem:THR CiteXplore:11964235 CiteXplore:22289691 |
|
| subClassOf |