loading...| Preferred Name |
mycophenolic acid |
|
| Synonyms |
acidum mycophenolicum C17H20O6 (E)-6-(4-Hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl)-4-methyl-4-hexenoic acid acide mycophenolique acido micofenolico mycophenolic acid Micofenolico acido Mycophenolsaeure Mycophenolate (4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_168396 |
|
| AHFScode |
92:00.00 |
|
| altId |
CHEBI:43973 |
|
| ATCCode |
L04AA06 |
|
| CASRN |
24280-93-1 |
|
| DBBrand |
melbex myfortic |
|
| DBname |
mycophenolic acid |
|
| DBSynonym |
mycophenoic acid |
|
| Definition |
A member of the class of 2-benzofurans that is 2-benzofuran-1(3H)-one which is substituted at positions 4, 5, 6, and 7 by methyl, methoxy, (2E)-5-carboxy-3-methylpent-2-en-1-yl, and hydroxy groups, respectively. It is an antibiotic produced by Penicillium brevi-compactum, P. stoloniferum, P. echinulatum and related species. An immunosuppressant, it is widely used (partiularly as its sodium salt and as the 2-(morpholin-4-yl)ethyl ester prodrug, mycophenolate mofetil) to prevent tissue rejection following organ transplants and for the treatment of certain autoimmune diseases. |
|
| has pharmacological target | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_22582 http://purl.obolibrary.org/obo/CHEBI_26619 |
|
| InChI |
InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ |
|
| InChIKey |
InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-N |
|
| inhibits | ||
| is metabolised by |
http://purl.obolibrary.org/obo/dinto_1890 http://purl.obolibrary.org/obo/dinto_1701 http://purl.obolibrary.org/obo/dinto_0265 |
|
| label |
mycophenolic acid |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_168396 |
|
| prefLabel |
mycophenolic acid |
|
| SMILES |
COc1c(C)c2COC(=O)c2c(O)c1C\\C=C(/C)CCC(O)=O COC1=C(C\C=C(/C)CCC(O)=O)C(O)=C2C(=O)OCC2=C1C |
|
| Synonym |
acidum mycophenolicum C17H20O6 (E)-6-(4-Hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl)-4-methyl-4-hexenoic acid acide mycophenolique acido micofenolico mycophenolic acid Micofenolico acido Mycophenolsaeure Mycophenolate (4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
|
| xref |
National Drug Code Directory:0078-0386-66 DrugBank:DB01024 CiteXplore:15470161 PDBeChem:MOA PharmGKB:PA164748728 KEGG DRUG:D05096 CiteXplore:16629948 CiteXplore:16640327 CASRN:24280-93-1 Reaxys:318158 Wikipedia:http://en.wikipedia.org/wiki/Mycophenolic_acid BindingDB:19264 PubChem Compound:446541 PDB:MOA ChemSpider:393865 Drugs.com:http://www.drugs.com/cdi/mycophenolic-acid-delayed-release-tablets.html DrugBank:24280-93-1 Drugs Product Database (DPD):2264560 CiteXplore:18611107 Wikipedia:Mycophenolic_acid CiteXplore:17498396 CiteXplore:11272311 Patent:US4753935 ChEBI:168396 CiteXplore:17482154 CiteXplore:18996104 CiteXplore:18194117 PubChem Substance:46504559 Beilstein:318158 CiteXplore:19689217 |
|
| subClassOf |