Preferred Name |
tolazamide |
|
Synonyms |
N-(azepan-1-ylcarbamoyl)-4-methylbenzenesulfonamide 4-(p-tolylsulfonyl)-1,1-hexamethylenesemicarbazide tolazamidum N-{[(hexahydro-1H-azepin-1-yl)-amino]carbonyl}-4-methylbenzenesulfonamide EINECS 214-588-3 1-(hexahydro-1-azepinyl)-3-p-tolylsulfonylurea N-(p-toluenesulfonyl)-N'-hexamethyleniminourea BRN 1323565 1-(hexahydro-1H-azepin-1-yl)-3-(p-tolylsulfonyl)urea CCRIS 591 Diabewas Norglycin Tolinase U 17835 U-17835 tolazamida tolazamide |
|
Definitions |
An N-sulfonylurea that is 1-tosylurea in which a hydrogen attached to the nitrogen at position 3 is replaced by an azepan-1-yl group. A hypoglycemic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9613 |
|
alternative_term |
N-(azepan-1-ylcarbamoyl)-4-methylbenzenesulfonamide |
|
charge |
0 |
|
database_cross_reference |
PMID:15901207 HMDB:HMDB0014977 PMID:8237731 Drug_Central:2694 CAS:1156-19-0 KEGG:D00379 Patent:GB887886 LINCS:LSM-2699 Reaxys:1323565 Wikipedia:Tolazamide DrugBank:DB00839 |
|
DrugsinVirtualScreening |
true |
|
formula |
C14H21N3O3S |
|
fromArticle |
true |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-(p-tolylsulfonyl)-1,1-hexamethylenesemicarbazide tolazamidum N-{[(hexahydro-1H-azepin-1-yl)-amino]carbonyl}-4-methylbenzenesulfonamide EINECS 214-588-3 1-(hexahydro-1-azepinyl)-3-p-tolylsulfonylurea N-(p-toluenesulfonyl)-N'-hexamethyleniminourea BRN 1323565 1-(hexahydro-1H-azepin-1-yl)-3-(p-tolylsulfonyl)urea CCRIS 591 Diabewas Norglycin Tolinase U 17835 U-17835 tolazamida tolazamide |
|
id |
CHEBI:9613 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18) |
|
inchikey |
OUDSBRTVNLOZBN-UHFFFAOYSA-N |
|
label |
tolazamide |
|
mass |
311.40000 |
|
monoisotopicmass |
311.13036 |
|
notation |
CHEBI:9613 |
|
prefLabel |
tolazamide |
|
see also | ||
smiles |
Cc1ccc(cc1)S(=O)(=O)NC(=O)NN1CCCCCC1 |
|
textual definition |
An N-sulfonylurea that is 1-tosylurea in which a hydrogen attached to the nitrogen at position 3 is replaced by an azepan-1-yl group. A hypoglycemic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
subClassOf |