Preferred Name |
cinchocaine |
|
Synonyms |
2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide CINCHOCAINE cinchocaine 2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide 2-butoxy-N-(beta-diethylaminoethyl)cinchoninamide 2-butoxy-N-(alpha-diethylaminoethyl)cinchoninamide alpha-butyloxycinchonic acid-gamma-diethylethylenediamine 2-N-butoxy-N-(2-diethylaminoethyl)cinchoninamide 2-butoxy-N-(2-(diethylamino)ethyl)cinchoninamide N-(2-(diethylamino)ethyl)-2-butoxycinchoninamide cinchocainum cincocainio alpha-butyloxycinchoninic acid diethylethylenediamide 2-Butoxy-quinoline-4-carboxylic acid (2-diethylamino-ethyl)-amide dibucaine base 2-butoxyquinoline-4-carboxylic acid diethylaminoethylamide DIBUCAINE Dibucaine dibucaine |
|
Definitions |
A monocarboxylic acid amide that is the 2-(diethylamino)ethyl amide of 2-butoxyquinoline-4-carboxylic acid. One of the most potent and toxic of the long-acting local anesthetics, its parenteral use was restricted to spinal anesthesia. It is now generally only used (usually as the hydrochloride) in creams and ointments and in suppositories for temporary relief of pain and itching associated with skin and anorectal conditions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_247956 |
|
alternative_term |
2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide CINCHOCAINE |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00733 Drug_Central:859 LINCS:LSM-6018 Wikipedia:Dibucaine Reaxys:275489 Beilstein:275489 DrugBank:DB00527 KEGG:C07879 PMID:23953476 HMDB:HMDB0014668 PMID:2873227 Patent:US1825623 CAS:85-79-0 |
|
DrugsinVirtualScreening |
true |
|
formula |
C20H29N3O2 |
|
fromArticle |
true |
|
has_alternative_id |
CHEBI:4500 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cinchocaine 2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide 2-butoxy-N-(beta-diethylaminoethyl)cinchoninamide 2-butoxy-N-(alpha-diethylaminoethyl)cinchoninamide alpha-butyloxycinchonic acid-gamma-diethylethylenediamine 2-N-butoxy-N-(2-diethylaminoethyl)cinchoninamide 2-butoxy-N-(2-(diethylamino)ethyl)cinchoninamide N-(2-(diethylamino)ethyl)-2-butoxycinchoninamide cinchocainum cincocainio alpha-butyloxycinchoninic acid diethylethylenediamide 2-Butoxy-quinoline-4-carboxylic acid (2-diethylamino-ethyl)-amide dibucaine base 2-butoxyquinoline-4-carboxylic acid diethylaminoethylamide DIBUCAINE Dibucaine dibucaine |
|
id |
CHEBI:247956 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
|
inchikey |
PUFQVTATUTYEAL-UHFFFAOYSA-N |
|
label |
cinchocaine |
|
mass |
343.46320 |
|
monoisotopicmass |
343.22598 |
|
notation |
CHEBI:247956 |
|
prefLabel |
cinchocaine |
|
see also | ||
smiles |
CCCCOc1cc(C(=O)NCCN(CC)CC)c2ccccc2n1 |
|
textual definition |
A monocarboxylic acid amide that is the 2-(diethylamino)ethyl amide of 2-butoxyquinoline-4-carboxylic acid. One of the most potent and toxic of the long-acting local anesthetics, its parenteral use was restricted to spinal anesthesia. It is now generally only used (usually as the hydrochloride) in creams and ointments and in suppositories for temporary relief of pain and itching associated with skin and anorectal conditions. |
|
subClassOf |