loading...| Preferred Name |
eltrombopag |
|
| Synonyms |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazinyl}-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid 3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazino}-2'-hydroxybiphenyl-3-carboxylic acid |
|
| Definitions |
A hydrazine in which each nitrogen atom is substituted, one by a 3'-carboxy-2-hydroxy[1,1'-biphenyl]-3-yl group and the other by a 1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene group. A small molecule agonist of the c-mpl (TpoR) receptor (the physiological target of the hormone thrombopoietin), it has been developed as a medication for conditions that lead to thrombocytopenia (abnormally low platelet counts). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_85010 |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| chemical has protein target as agonist | ||
| database_cross_reference |
CAS:496775-61-2 Wikipedia:Eltrombopag PMID:25400215 PMID:25063763 PMID:24433306 PMID:25700916 PMID:25578417 Drug_Central:4399 PMID:25170628 |
|
| definition source |
https://www.drugbank.ca/drugs/DB06210 PMID: 32366720 |
|
| formula |
C25H22N4O4 |
|
| has exact synonym |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazinyl}-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazino}-2'-hydroxybiphenyl-3-carboxylic acid |
|
| id |
CHEBI:85010 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C25H22N4O4/c1-14-10-11-19(12-15(14)2)29-24(31)22(16(3)28-29)27-26-21-9-5-8-20(23(21)30)17-6-4-7-18(13-17)25(32)33/h4-13,26,30H,1-3H3,(H,32,33)/b27-22- |
|
| inchikey |
XDXWLKQMMKQXPV-QYQHSDTDSA-N |
|
| label |
eltrombopag |
|
| mass |
442.46660 |
|
| monoisotopicmass |
442.16411 |
|
| notation |
CHEBI:85010 |
|
| prefLabel |
eltrombopag |
|
| smiles |
CC1=NN(C(=O)\C1=N/Nc1cccc(-c2cccc(c2)C(O)=O)c1O)c1ccc(C)c(C)c1 |
|
| textual definition |
A hydrazine in which each nitrogen atom is substituted, one by a 3'-carboxy-2-hydroxy[1,1'-biphenyl]-3-yl group and the other by a 1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene group. A small molecule agonist of the c-mpl (TpoR) receptor (the physiological target of the hormone thrombopoietin), it has been developed as a medication for conditions that lead to thrombocytopenia (abnormally low platelet counts). |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22723 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.