loading...| Preferred Name |
pioglitazone |
|
| Synonyms |
5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione Pioglitazone pioglitazone pioglitazonum (+-)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione pioglitazona |
|
| Definitions |
A member of the class of thiazolidenediones that is 1,3-thiazolidine-2,4-dione substituted by a benzyl group at position 5 which in turn is substituted by a 2-(5-ethylpyridin-2-yl)ethoxy group at position 4 of the phenyl ring. It exhibits hypoglycemic activity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8228 |
|
| charge |
0 |
|
| chemical inhibits protein | ||
| database_cross_reference |
PMID:12879407 PMID:33798599 Patent:EP193256 KEGG:D08378 Chemspider:4663 PMID:34009030 PMID:33995271 CAS:111025-46-8 DrugBank:DB01132 Wikipedia:Pioglitazone PMID:18215232 HMDB:HMDB0015264 LINCS:LSM-1592 PMID:34006325 PMID:14522601 Patent:US4687777 PMID:20797618 Beilstein:3595485 PMID:27842070 KEGG:C07675 PMID:33983968 PMID:17628757 Reaxys:3595485 Drug_Central:2179 PMID:33864097 |
|
| definition source |
Reference: PMID: 27510639 |
|
| formula |
C19H20N2O3S |
|
| has exact synonym |
5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione Pioglitazone |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_71554 http://purl.obolibrary.org/obo/CHEBI_83157 http://purl.obolibrary.org/obo/CHEBI_35526 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_77307 http://purl.obolibrary.org/obo/CHEBI_77194 http://purl.obolibrary.org/obo/CHEBI_173084 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pioglitazone pioglitazonum (+-)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione pioglitazona |
|
| id |
CHEBI:8228 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
|
| inchikey |
HYAFETHFCAUJAY-UHFFFAOYSA-N |
|
| label |
pioglitazone |
|
| mass |
356.43978 |
|
| monoisotopicmass |
356.11946 |
|
| notation |
CHEBI:8228 |
|
| prefLabel |
pioglitazone |
|
| smiles |
CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
|
| textual definition |
A member of the class of thiazolidenediones that is 1,3-thiazolidine-2,4-dione substituted by a benzyl group at position 5 which in turn is substituted by a 2-(5-ethylpyridin-2-yl)ethoxy group at position 4 of the phenyl ring. It exhibits hypoglycemic activity. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.