loading...| Preferred Name |
phenazopyridine |
|
| Synonyms |
3-(Phenylazo)-2,6-pyridinediamine fenazopiridina phenazopyridine 2,6-Diamino-3-(phenylazo)pyridine phenazopyridinum 2,6-Diamino-3-phenylazopyridine 3-(phenyldiazenyl)pyridine-2,6-diamine |
|
| Definitions |
A diaminopyridine that is 2,6-diaminopyridine substituted at position 3 by a phenylazo group. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_71416 |
|
| alternative term |
3-(Phenylazo)-2,6-pyridinediamine fenazopiridina phenazopyridine 2,6-Diamino-3-(phenylazo)pyridine phenazopyridinum 2,6-Diamino-3-phenylazopyridine 3-(phenyldiazenyl)pyridine-2,6-diamine |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| chemical has protein target | ||
| chemical inhibits protein | ||
| database_cross_reference |
DrugBank:DB01438 PMID:21789523 PMID:19300288 PMID:22110938 LINCS:LSM-3705 PMID:21376167 Wikipedia:Phenazopyridine KEGG:C07429 KEGG:D08346 PMID:21856805 PMID:20976818 PMID:23030327 Reaxys:184497 CAS:94-78-0 HMDB:HMDB0015506 PMID:20467292 PMID:20636989 PMID:21681956 PMID:21147318 PMID:20196783 PMID:22987905 PMID:28166217 Patent:WO2008033466 Patent:WO2010071878 Patent:US2009247628 Beilstein:184497 PMID:19744778 |
|
| definition source |
https://www.drugbank.ca/drugs/DB01438 PMID: 30918074 |
|
| formula |
C11H11N5 |
|
| has exact synonym |
3-(phenyldiazenyl)pyridine-2,6-diamine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
| has_alternative_id |
CHEBI:8057 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(Phenylazo)-2,6-pyridinediamine fenazopiridina phenazopyridine 2,6-Diamino-3-(phenylazo)pyridine phenazopyridinum 2,6-Diamino-3-phenylazopyridine |
|
| id |
CHEBI:71416 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C11H11N5/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8/h1-7H,(H4,12,13,14) |
|
| inchikey |
QPFYXYFORQJZEC-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
phenazopyridine |
|
| mass |
213.23850 |
|
| monoisotopicmass |
213.10145 |
|
| notation |
CHEBI:71416 |
|
| prefLabel |
phenazopyridine |
|
| smiles |
Nc1ccc(N=Nc2ccccc2)c(N)n1 |
|
| textual definition |
A diaminopyridine that is 2,6-diaminopyridine substituted at position 3 by a phenylazo group. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.