loading...| Preferred Name |
valproic acid |
|
| Synonyms |
2-propylpentanoic acid VALPROIC ACID valproic acid Di-n-propylessigsaeure 2-PROPYL-PENTANOIC ACID 2-propylvaleric acid acido valproico Valproinsaeure 2-n-propyl-n-valeric acid di-n-propylacetic acid dipropylacetic acid acide valproique acidum valproicum 4-heptanecarboxylic acid DPA Depakene VPA n-DPA |
|
| Definitions |
A branched-chain saturated fatty acid that comprises of a propyl substituent on a pentanoic acid stem. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_39867 |
|
| charge |
0 |
|
| chemical inhibits protein | ||
| database_cross_reference |
PMID:8558327 PMID:11716839 PMID:16759735 Reaxys:1750447 Beilstein:1750447 KEGG:D00399 Drug_Central:2803 PMID:19318486 CAS:99-66-1 PMID:16496131 DrugBank:DB00313 LINCS:LSM-4620 PMID:16621443 PMID:24135375 PMID:23792104 PMID:15578701 PMID:17273758 Wikipedia:Valproic_Acid PDBeChem:2PP PMID:12475192 KEGG:C07185 PMID:15560954 PMID:17156483 PMID:15124690 PMID:19280426 LIPID_MAPS_instance:LMFA01020291 PMID:23810771 PMID:8681902 HMDB:HMDB0001877 PMID:23949302 PMID:24348849 PMID:24200999 |
|
| definition source |
Reference: PMID: 11742974 |
|
| formula |
C8H16O2 |
|
| has exact synonym |
2-propylpentanoic acid VALPROIC ACID |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_35477 http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_51374 http://purl.obolibrary.org/obo/CHEBI_61115 |
|
| has_alternative_id |
CHEBI:115217 CHEBI:39858 CHEBI:9926 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
valproic acid 2-propylpentanoic acid Di-n-propylessigsaeure 2-PROPYL-PENTANOIC ACID 2-propylvaleric acid acido valproico Valproinsaeure 2-n-propyl-n-valeric acid di-n-propylacetic acid dipropylacetic acid acide valproique acidum valproicum 4-heptanecarboxylic acid DPA Depakene VPA n-DPA |
|
| has_role | ||
| id |
CHEBI:39867 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
|
| inchikey |
NIJJYAXOARWZEE-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
valproic acid |
|
| mass |
144.21140 |
|
| monoisotopicmass |
144.11503 |
|
| notation |
CHEBI:39867 |
|
| prefLabel |
valproic acid |
|
| smiles |
CCCC(CCC)C(O)=O |
|
| textual definition |
A branched-chain saturated fatty acid that comprises of a propyl substituent on a pentanoic acid stem. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.