loading...| Preferred Name |
baicalin |
|
| Synonyms |
5,6,7-trihydroxyflavone 7-O-beta-D-glucuronide baicalein 7-glucuronide 7-D-glucuronic acid-5,6-dihydroxyflavone 5,6-dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl beta-D-glucopyranosiduronic acid baicalein 7-O-glucuronide 5,6-dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl beta-D-glucopyranosiduronic acid Baicalin |
|
| Definitions |
The glycosyloxyflavone which is the 7-O-glucuronide of baicalein. It is an active ingredient of Chinese herbal medicine Scutellaria baicalensis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2981 |
|
| alternative term |
5,6,7-trihydroxyflavone 7-O-beta-D-glucuronide baicalein 7-glucuronide 7-D-glucuronic acid-5,6-dihydroxyflavone 5,6-dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl beta-D-glucopyranosiduronic acid baicalein 7-O-glucuronide 5,6-dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl beta-D-glucopyranosiduronic acid Baicalin |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| database_cross_reference |
PMID:33935719 Wikipedia:Baicalin PMID:33781030 CAS:21967-41-9 PMID:33595821 PMID:33921971 PMID:33652818 PMID:23523628 Reaxys:70480 KNApSAcK:C00001024 PMID:21087019 PMID:33732310 PMCID:PMC8165801 PMID:34029124 PMID:33269624 PMID:33224035 PMID:33008383 PMID:33992597 PMID:32795339 PMID:33352232 PMID:23354080 PMID:18650094 LIPID_MAPS_instance:LMPK12111081 Patent:CN102584918 Drug_Central:4055 Beilstein:70480 PMID:23302221 KEGG:C10025 PMID:34044073 PMID:33801847 PMID:33923637 MetaCyc:CPD-12725 PMID:23142347 PMID:33891262 PMID:25847243 PMID:22467027 PMID:34053448 Patent:WO2012119458 PMID:10724177 PMID:32707128 PMID:33493657 PMID:33815110 HMDB:HMDB0041832 PMID:33955315 PDBeChem:0XE |
|
| definition source |
PMID: 15288617 |
|
| formula |
C21H18O11 |
|
| has exact synonym |
5,6-dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl beta-D-glucopyranosiduronic acid Baicalin |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_77307 http://purl.obolibrary.org/obo/CHEBI_145947 http://purl.obolibrary.org/obo/CHEBI_173084 http://purl.obolibrary.org/obo/CHEBI_76779 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_170010 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5,6,7-trihydroxyflavone 7-O-beta-D-glucuronide baicalein 7-glucuronide 7-D-glucuronic acid-5,6-dihydroxyflavone 5,6-dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl beta-D-glucopyranosiduronic acid baicalein 7-O-glucuronide |
|
| id |
CHEBI:2981 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C21H18O11/c22-9-6-10(8-4-2-1-3-5-8)30-11-7-12(14(23)15(24)13(9)11)31-21-18(27)16(25)17(26)19(32-21)20(28)29/h1-7,16-19,21,23-27H,(H,28,29)/t16-,17-,18+,19-,21+/m0/s1 |
|
| inchikey |
IKIIZLYTISPENI-ZFORQUDYSA-N |
|
| is conjugate acid of | ||
| label |
baicalin |
|
| mass |
446.364 |
|
| monoisotopicmass |
446.08491 |
|
| notation |
CHEBI:2981 |
|
| prefLabel |
baicalin |
|
| smiles |
O[C@@H]1[C@@H](O)[C@H](OC2=CC3=C(C(=O)C=C(O3)C3=CC=CC=C3)C(O)=C2O)O[C@@H]([C@H]1O)C(O)=O |
|
| textual definition |
The glycosyloxyflavone which is the 7-O-glucuronide of baicalein. It is an active ingredient of Chinese herbal medicine Scutellaria baicalensis. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24302 http://purl.obolibrary.org/obo/CHEBI_50018 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.