loading...| Preferred Name |
amodiaquine |
|
| Synonyms |
4-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol Amodiaquine amodiaquina amodiaquine amodiaquinum |
|
| Definitions |
A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2674 |
|
| charge |
0 |
|
| chemical inhibits in vitro invasion of virus | ||
| chemical inhibits protein | ||
| database_cross_reference |
PMID:17222819 PMID:27031231 PMID:11044276 Reaxys:300962 PMID:26206402 PMID:26900802 PMID:26851641 CAS:86-42-0 LINCS:LSM-4042 Beilstein:300962 PMID:26930583 PMID:19024339 PMID:26647924 PMID:18419816 PMID:8885219 Drug_Central:186 KEGG:D02922 DrugBank:DB00613 PDBeChem:CQA PMID:18855526 PMID:19245687 KEGG:C07626 Patent:US2474821 PMID:26597254 PMID:17046445 Wikipedia:Amodiaquine PMID:11971651 PMID:26735991 |
|
| definition source |
https://www.drugbank.ca/drugs/DB00613 PMID: 32366720; PMID: 30700611 |
|
| formula |
C20H22ClN3O |
|
| has exact synonym |
4-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol Amodiaquine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_110725 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
amodiaquina amodiaquine amodiaquinum |
|
| id |
CHEBI:2674 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C20H22ClN3O/c1-3-24(4-2)13-14-11-16(6-8-20(14)25)23-18-9-10-22-19-12-15(21)5-7-17(18)19/h5-12,25H,3-4,13H2,1-2H3,(H,22,23) |
|
| inchikey |
OVCDSSHSILBFBN-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
amodiaquine |
|
| mass |
355.86100 |
|
| monoisotopicmass |
355.14514 |
|
| notation |
CHEBI:2674 |
|
| prefLabel |
amodiaquine |
|
| smiles |
CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O |
|
| textual definition |
A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_36709 http://purl.obolibrary.org/obo/CHEBI_33853 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.