loading...| Preferred Name |
L-asparagine |
|
| Synonyms |
L-asparagine L-Asparagine alpha-aminosuccinamic acid (S)-Asparagine (2S)-2,4-diamino-4-oxobutanoic acid L-aspartic acid beta-amide L-Asparagin 2-Aminosuccinamic acid L-2-aminosuccinamic acid (S)-2-amino-3-carbamoylpropanoic acid (2S)-2-amino-3-carbamoylpropanoic acid Aspartamic acid ASPARAGINE Asn N |
|
| Definitions |
An optically active form of asparagine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17196 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1723527 PMID:21800258 Wikipedia:Asparagine YMDB:YMDB00226 PMID:16190636 PMID:21854356 PDBeChem:ASN FooDB:FDB000787 PMID:12142634 PMID:16368161 DrugBank:DB00174 CAS:70-47-3 Reaxys:1723527 PMID:16668324 Drug_Central:4126 ECMDB:ECMDB00168 PMID:17497286 PMID:15907185 KEGG:C00152 KNApSAcK:C00001341 MetaCyc:ASN PMID:22513289 Gmelin:3334 HMDB:HMDB0000168 |
|
| formula |
C4H8N2O3 |
|
| has exact synonym |
L-asparagine L-Asparagine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:40902 CHEBI:21242 CHEBI:13083 CHEBI:6191 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha-aminosuccinamic acid (S)-Asparagine (2S)-2,4-diamino-4-oxobutanoic acid L-aspartic acid beta-amide L-Asparagin 2-Aminosuccinamic acid L-2-aminosuccinamic acid (S)-2-amino-3-carbamoylpropanoic acid (2S)-2-amino-3-carbamoylpropanoic acid Aspartamic acid ASPARAGINE Asn N |
|
| id |
CHEBI:17196 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1 |
|
| inchikey |
DCXYFEDJOCDNAF-REOHCLBHSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-asparagine |
|
| mass |
132.11800 |
|
| monoisotopicmass |
132.05349 |
|
| notation |
CHEBI:17196 |
|
| prefLabel |
L-asparagine |
|
| smiles |
N[C@@H](CC(N)=O)C(O)=O |
|
| textual definition |
An optically active form of asparagine having L-configuration. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_22658 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.