loading...| Preferred Name |
L-threonine |
|
| Synonyms |
L-Threonine L-threonine (2S,3R)-2-amino-3-hydroxybutanoic acid L-alpha-amino-beta-hydroxybutyric acid (2S,3R)-(-)-Threonine 2-Amino-3-hydroxybutyric acid L-(-)-Threonine L-2-Amino-3-hydroxybutyric acid (2S)-threonine L-Threonin T THREONINE Thr |
|
| Definitions |
An optically active form of threonine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16857 |
|
| charge |
0 |
|
| database_cross_reference |
YMDB:YMDB00214 Beilstein:1721646 PMID:24671569 Drug_Central:4254 HMDB:HMDB0000167 KEGG:C00188 DrugBank:DB00156 Wikipedia:Threonine Gmelin:82510 KEGG:D00041 UM-BBD_compID:c0413 PMID:17379183 PDBeChem:THR PMID:22289691 PMID:12523390 PMID:11964235 PMID:16659349 PMID:22513921 KNApSAcK:C00001394 PMID:22342587 PMID:22770225 ECMDB:ECMDB00167 CAS:72-19-5 Reaxys:1721646 |
|
| formula |
C4H9NO3 |
|
| has exact synonym |
L-Threonine L-threonine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
| has_alternative_id |
CHEBI:45843 CHEBI:42083 CHEBI:45983 CHEBI:21403 CHEBI:13175 CHEBI:6308 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(2S,3R)-2-amino-3-hydroxybutanoic acid L-alpha-amino-beta-hydroxybutyric acid (2S,3R)-(-)-Threonine 2-Amino-3-hydroxybutyric acid L-(-)-Threonine L-2-Amino-3-hydroxybutyric acid (2S)-threonine L-Threonin T THREONINE Thr |
|
| id |
CHEBI:16857 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 |
|
| inchikey |
AYFVYJQAPQTCCC-GBXIJSLDSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-threonine |
|
| mass |
119.11920 |
|
| monoisotopicmass |
119.05824 |
|
| notation |
CHEBI:16857 |
|
| prefLabel |
L-threonine |
|
| smiles |
C[C@@H](O)[C@H](N)C(O)=O |
|
| textual definition |
An optically active form of threonine having L-configuration. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26986 http://purl.obolibrary.org/obo/CHEBI_83813 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.