loading...| Preferred Name |
cytosine |
|
| Synonyms |
4-aminopyrimidin-2(1H)-one Cytosine cytosine 4-amino-2(1H)-pyrimidinone 4-amino-2-hydroxypyrimidine C Cyt Cytosin Zytosin |
|
| Definitions |
An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16040 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:7877593 Beilstein:2637 KNApSAcK:C00001498 Wikipedia:Cytosine Reaxys:2637 KEGG:C00380 PMID:14253484 PMID:22770225 MetaCyc:CYTOSINE Gmelin:82472 HMDB:HMDB0000630 CAS:71-30-7 PDBeChem:CYT |
|
| formula |
C4H5N3O |
|
| has exact synonym |
4-aminopyrimidin-2(1H)-one Cytosine cytosine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:41732 CHEBI:23531 CHEBI:14066 CHEBI:4072 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-amino-2(1H)-pyrimidinone 4-amino-2-hydroxypyrimidine C Cyt Cytosin Zytosin |
|
| id |
CHEBI:16040 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8) |
|
| inchikey |
OPTASPLRGRRNAP-UHFFFAOYSA-N |
|
| label |
cytosine |
|
| mass |
111.10212 |
|
| monoisotopicmass |
111.04326 |
|
| notation |
CHEBI:16040 |
|
| prefLabel |
cytosine |
|
| smiles |
Nc1cc[nH]c(=O)n1 |
|
| textual definition |
An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38337 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.