loading...| Preferred Name |
peramivir |
|
| Synonyms |
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-carbamimidamido-2-hydroxycyclopentane-1-carboxylic acid RWJ270201 RWJ 270201 3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid BCX 1812 BCX-1812 BCX1812 RWJ-270201 |
|
| Definitions |
A member of the class of guanidines that is used (as its trihydrate) for the treatment of acute uncomplicated influenza in patients 18 years and older who have been symptomatic for no more than two days. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_85202 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:25523716 CAS:330600-85-6 PMID:24517996 PMID:25231091 PMID:25697190 Drug_Central:4823 Wikipedia:Peramivir PMID:25691635 PMID:25547357 PMID:25277670 PMID:25752738 PDBeChem:BCZ Reaxys:9011170 |
|
| definition |
A member of the class of guanidines that is used (as its trihydrate) for the treatment of acute uncomplicated influenza in patients 18 years and older who have been symptomatic for no more than two days. |
|
| formula |
C15H28N4O4 |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:41095 |
|
| has_exact_synonym |
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-carbamimidamido-2-hydroxycyclopentane-1-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
RWJ270201 RWJ 270201 3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid BCX 1812 BCX-1812 BCX1812 RWJ-270201 |
|
| id |
CHEBI:85202 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H28N4O4/c1-4-8(5-2)12(18-7(3)20)11-10(19-15(16)17)6-9(13(11)21)14(22)23/h8-13,21H,4-6H2,1-3H3,(H,18,20)(H,22,23)(H4,16,17,19)/t9-,10+,11+,12-,13+/m0/s1 |
|
| inchikey |
XRQDFNLINLXZLB-CKIKVBCHSA-N |
|
| label |
peramivir |
|
| mass |
328.40720 |
|
| monoisotopicmass |
328.21106 |
|
| notation |
CHEBI:85202 |
|
| prefLabel |
peramivir |
|
| smiles |
CCC(CC)[C@H](NC(C)=O)[C@@H]1[C@H](O)[C@H](C[C@H]1NC(N)=N)C(O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22160 http://purl.obolibrary.org/obo/CHEBI_24436 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22160 http://purl.obolibrary.org/obo/CHEBI_24436 |