Preferred Name |
nimodipine |
|
Synonyms |
Nimodipine 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate nimodipinum 2,6-dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-beta-methoxyethyl ester 5-isopropyl ester BAY e 9736 isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate nimodipine nimodipino Periplum Nimotop |
|
Definitions |
A dihydropyridine that is 1,4-dihydropyridine which is substituted by methyl groups at positions 2 and 6, a (2-methoxyethoxy)carbonyl group at position 3, a m-nitrophenyl group at position 4, and an isopropoxycarbonyl group at position 5. An L-type calcium channel blocker, it acts particularly on cerebral circulation, and is used both orally and intravenously for the prevention and treatment of subarachnoid hemorrhage from ruptured intracranial aneurysm. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7575 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1659 PMID:8519001 PMID:22262041 PMID:17110283 Reaxys:459792 KEGG:C07267 DrugBank:DB00393 Patent:US3799934 KEGG:D00438 Patent:DE2117571 PMID:21869451 Drug_Central:1937 PMID:22300914 CAS:66085-59-4 PMID:12137606 PMID:16180362 Wikipedia:Nimodipine |
|
definition |
A dihydropyridine that is 1,4-dihydropyridine which is substituted by methyl groups at positions 2 and 6, a (2-methoxyethoxy)carbonyl group at position 3, a m-nitrophenyl group at position 4, and an isopropoxycarbonyl group at position 5. An L-type calcium channel blocker, it acts particularly on cerebral circulation, and is used both orally and intravenously for the prevention and treatment of subarachnoid hemorrhage from ruptured intracranial aneurysm. |
|
formula |
C21H26N2O7 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_38215 |
|
has_exact_synonym |
Nimodipine 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
nimodipinum 2,6-dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-beta-methoxyethyl ester 5-isopropyl ester BAY e 9736 isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate nimodipine nimodipino Periplum Nimotop |
|
id |
CHEBI:7575 |
|
in_subset | ||
inchi |
InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
|
inchikey |
UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
|
label |
nimodipine |
|
mass |
418.44030 |
|
monoisotopicmass |
418.17400 |
|
notation |
CHEBI:7575 |
|
prefLabel |
nimodipine |
|
smiles |
COCCOC(=O)C1=C(C)NC(C)=C(C1c1cccc(c1)[N+]([O-])=O)C(=O)OC(C)C |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_50075 http://purl.obolibrary.org/obo/CHEBI_35725 http://purl.obolibrary.org/obo/CHEBI_51307 http://purl.obolibrary.org/obo/CHEBI_136838 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50075 http://purl.obolibrary.org/obo/CHEBI_35725 http://purl.obolibrary.org/obo/CHEBI_51307 http://purl.obolibrary.org/obo/CHEBI_136838 |