loading...| Preferred Name |
phenazopyridine |
|
| Synonyms |
3-(phenyldiazenyl)pyridine-2,6-diamine 3-(Phenylazo)-2,6-pyridinediamine phenazopyridine phenazopyridinum 2,6-Diamino-3-phenylazopyridine 2,6-Diamino-3-(phenylazo)pyridine fenazopiridina |
|
| Definitions |
A diaminopyridine that is 2,6-diaminopyridine substituted at position 3 by a phenylazo group. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_71416 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:WO2010071878 Patent:WO2008033466 LINCS:LSM-3705 PMID:28166217 HMDB:HMDB0015506 KEGG:D08346 Wikipedia:Phenazopyridine PMID:21856805 PMID:21147318 PMID:19744778 KEGG:C07429 DrugBank:DB01438 Patent:US2009247628 Reaxys:184497 PMID:21681956 PMID:19300288 PMID:22987905 PMID:20636989 PMID:20467292 PMID:22110938 CAS:94-78-0 PMID:23030327 Beilstein:184497 PMID:21789523 PMID:20196783 PMID:21376167 PMID:20976818 |
|
| definition |
A diaminopyridine that is 2,6-diaminopyridine substituted at position 3 by a phenylazo group. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. |
|
| formula |
C11H11N5 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
| has_alternative_id |
CHEBI:8057 |
|
| has_exact_synonym |
3-(phenyldiazenyl)pyridine-2,6-diamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(Phenylazo)-2,6-pyridinediamine phenazopyridine phenazopyridinum 2,6-Diamino-3-phenylazopyridine 2,6-Diamino-3-(phenylazo)pyridine fenazopiridina |
|
| id |
CHEBI:71416 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H11N5/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8/h1-7H,(H4,12,13,14) |
|
| inchikey |
QPFYXYFORQJZEC-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
phenazopyridine |
|
| mass |
213.23850 |
|
| monoisotopicmass |
213.10145 |
|
| notation |
CHEBI:71416 |
|
| prefLabel |
phenazopyridine |
|
| smiles |
Nc1ccc(N=Nc2ccccc2)c(N)n1 |
|
| treeView | ||
| subClassOf |