loading...| Preferred Name |
sodium chlorate |
|
| Synonyms |
sodium chlorate Chlorate salt of sodium Chlorsaure Chloric acid, sodium salt Chlorate de sodium |
|
| Definitions |
An inorganic sodium salt that has chlorate as the counter-ion. An oxidising agent, it is used for bleaching paper and as a herbicide. It is also used in the manufacture of dyes, explosives and matches. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_65242 |
|
| charge |
0 |
|
| database_cross_reference |
PPDB:1126 Wikipedia:Sodium_chlorate PMID:22366135 Reaxys:11332523 PMID:22205670 KEGG:C18765 CAS:7775-09-9 |
|
| definition |
An inorganic sodium salt that has chlorate as the counter-ion. An oxidising agent, it is used for bleaching paper and as a herbicide. It is also used in the manufacture of dyes, explosives and matches. |
|
| formula |
ClNaO3 |
|
| has role | ||
| has_exact_synonym |
sodium chlorate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Chlorate salt of sodium Chlorsaure Chloric acid, sodium salt Chlorate de sodium |
|
| id |
CHEBI:65242 |
|
| in_subset | ||
| inchi |
InChI=1S/ClHO3.Na/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 |
|
| inchikey |
YZHUMGUJCQRKBT-UHFFFAOYSA-M |
|
| label |
sodium chlorate |
|
| mass |
106.44100 |
|
| monoisotopicmass |
105.94337 |
|
| notation |
CHEBI:65242 |
|
| prefLabel |
sodium chlorate |
|
| smiles |
[Na+].[O-]Cl(=O)=O |
|
| treeView | ||
| subClassOf |