Preferred Name |
levamisole |
|
Synonyms |
(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (S)-(-)-levamisole levamisol (S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole Ketrax (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole Levomysol levamisolum (-)-tetramisole Wormicid levamisole Totalon Lepuron Levovermax (S)-(-)-tetramisole (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|
Definitions |
A 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole that has S configuration. It is used (generally as the monohydrochloride salt) to treat parasitic worm infections in pigs, sheep and cattle and was formerly used in humans as an adjuvant to chemotherapy for the treatment of various cancers. It is also widely used as an adulterant to coccaine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6432 |
|
charge |
0 |
|
database_cross_reference |
PMID:17608969 PMID:366137 PMID:6995094 Patent:US3579530 PMID:23152411 PMID:24440755 PMID:669135 PMID:6995092 LINCS:LSM-6655 PMID:23543977 PMID:22607692 PMID:1618599 PMID:827785 Reaxys:4233256 Wikipedia:Levamisole PMID:12749943 PMID:10701095 HMDB:HMDB0014986 PMID:366135 CAS:14769-73-4 PMID:189006 Patent:US3274209 DrugBank:DB00848 PMID:7051554 PMID:23921349 PMID:23649929 Drug_Central:1561 Patent:US3565907 PMID:23041983 PMID:15109274 PMID:22337783 PMID:24365689 PMID:12232676 KEGG:C07070 KEGG:D08114 PMID:365327 PMID:23577329 VSDB:1798 PMID:2050823 |
|
definition |
A 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole that has S configuration. It is used (generally as the monohydrochloride salt) to treat parasitic worm infections in pigs, sheep and cattle and was formerly used in humans as an adjuvant to chemotherapy for the treatment of various cancers. It is also widely used as an adulterant to coccaine. |
|
formula |
C11H12N2S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50846 http://purl.obolibrary.org/obo/CHEBI_50847 http://purl.obolibrary.org/obo/CHEBI_35444 |
|
has_exact_synonym |
(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(S)-(-)-levamisole levamisol (S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole Ketrax (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole Levomysol levamisolum (-)-tetramisole Wormicid levamisole Totalon Lepuron Levovermax (S)-(-)-tetramisole (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|
id |
CHEBI:6432 |
|
in_subset | ||
inchi |
InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
|
inchikey |
HLFSDGLLUJUHTE-SNVBAGLBSA-N |
|
is enantiomer of | ||
label |
levamisole |
|
mass |
204.29100 |
|
monoisotopicmass |
204.07212 |
|
notation |
CHEBI:6432 |
|
prefLabel |
levamisole |
|
smiles |
C1CN2C[C@@H](N=C2S1)c1ccccc1 |
|
treeView | ||
subClassOf |