loading...| Preferred Name |
granisetron |
|
| Synonyms |
1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide APF 530 BRL 43694 Kevatril Sustol 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide granisetronum APF530 Sancuso granisetron |
|
| Definitions |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 1-methyl-1H-indazole-3-carboxylic acid with the primary amino group of (3-endo)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. A selective 5-HT3 receptor antagonist, it is used (generally as the monohydrochloride salt) to manage nausea and vomiting caused by cancer chemotherapy and radiotherapy, and to prevent and treat postoperative nausea and vomiting. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5537 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:3655275 PMID:25834466 PMID:24388937 PMID:27895421 PMID:26997579 PMID:27915445 PMID:2169778 PMID:26925101 Patent:EP200444 PMID:28211304 PMID:2540014 CAS:109889-09-0 PMID:27650869 PMID:28002447 PMID:27809336 Drug_Central:1329 PMID:27186139 Wikipedia:Granisetron PMID:26812081 KEGG:D04370 PMID:27571447 Patent:US4886808 PMID:27358385 PMID:28168082 PMID:25866983 HMDB:HMDB0015026 PMID:27382819 PMID:27129842 PMID:27162748 PMID:22452942 PMID:27400689 PMID:28061543 PMID:27746523 PMID:26289588 PMID:27703112 KEGG:C07023 DrugBank:DB00889 PMID:27184113 PMID:27073822 PMID:1650335 PDBeChem:CWB |
|
| definition |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 1-methyl-1H-indazole-3-carboxylic acid with the primary amino group of (3-endo)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. A selective 5-HT3 receptor antagonist, it is used (generally as the monohydrochloride salt) to manage nausea and vomiting caused by cancer chemotherapy and radiotherapy, and to prevent and treat postoperative nausea and vomiting. |
|
| formula |
C18H24N4O |
|
| has role | ||
| has_exact_synonym |
1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
APF 530 BRL 43694 Kevatril Sustol 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide granisetronum APF530 Sancuso granisetron |
|
| id |
CHEBI:5537 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14- |
|
| inchikey |
MFWNKCLOYSRHCJ-BTTYYORXSA-N |
|
| label |
granisetron |
|
| mass |
312.40940 |
|
| monoisotopicmass |
312.19501 |
|
| notation |
CHEBI:5537 |
|
| prefLabel |
granisetron |
|
| smiles |
CN1[C@H]2CCC[C@@H]1C[C@@H](C2)NC(=O)c1nn(C)c2ccccc12 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_29347 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_29347 |