Jump to:
loading...| Preferred Name |
benzyl acetate |
|
| Synonyms |
phenylmethyl acetate benzyl acetate Benzyl ethanoate Phenylmethyl ethanoate Acetic acid, benzyl ester Acetic acid, phenylmethyl ester |
|
| Definitions |
The acetate ester of benzyl alcohol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52051 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:140-11-4 Beilstein:1908121 PDBeChem:J0Z KEGG:C15513 |
|
| definition |
The acetate ester of benzyl alcohol. |
|
| formula |
C9H10O2 |
|
| has role | ||
| has_exact_synonym |
phenylmethyl acetate benzyl acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Benzyl ethanoate Phenylmethyl ethanoate Acetic acid, benzyl ester Acetic acid, phenylmethyl ester |
|
| id |
CHEBI:52051 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
|
| inchikey |
QUKGYYKBILRGFE-UHFFFAOYSA-N |
|
| label |
benzyl acetate |
|
| mass |
150.175 |
|
| monoisotopicmass |
150.06808 |
|
| notation |
CHEBI:52051 |
|
| prefLabel |
benzyl acetate |
|
| smiles |
CC(=O)OCC1=CC=CC=C1 |
|
| treeView | ||
| subClassOf |
Create mapping