Preferred Name |
fenoprofen |
|
Synonyms |
(+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen 2-(m-phenoxyphenyl)propionic acid fenoprofene fenoprofeno 2-(3-phenoxyphenyl)propionic acid alpha-(m-phenoxyphenyl)propionic acid fenoprofenum (+-)-m-phenoxyhydratropic acid alpha-methyl-3-phenoxybenzeneacetic acid Fenoprofen FENOPROFEN 2-(3-phenoxyphenyl)propanoic acid |
|
Definitions |
A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5004 |
|
charge |
0 |
|
database_cross_reference |
PMID:21328296 PMID:25554116 PMID:21342694 PMID:28166217 KEGG:D02350 PMID:30168706 CAS:31879-05-7 Patent:US3600437 Wikipedia:_Fenoprofen Drug_Central:1154 PMID:4616811 KEGG:C06997 DrugBank:DB00573 Reaxys:2118687 |
|
definition |
A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
formula |
C15H14O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
has_alternative_id |
CHEBI:355534 |
|
has_exact_synonym |
Fenoprofen FENOPROFEN 2-(3-phenoxyphenyl)propanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen 2-(m-phenoxyphenyl)propionic acid fenoprofene fenoprofeno 2-(3-phenoxyphenyl)propionic acid alpha-(m-phenoxyphenyl)propionic acid fenoprofenum (+-)-m-phenoxyhydratropic acid alpha-methyl-3-phenoxybenzeneacetic acid |
|
id |
CHEBI:5004 |
|
in_subset | ||
inchi |
InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
|
inchikey |
RDJGLLICXDHJDY-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
fenoprofen |
|
mass |
242.26990 |
|
monoisotopicmass |
242.09429 |
|
notation |
CHEBI:5004 |
|
prefLabel |
fenoprofen |
|
smiles |
CC(C(O)=O)c1cccc(Oc2ccccc2)c1 |
|
treeView | ||
subClassOf |