Preferred Name |
clavulanate |
|
Synonyms |
(2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate clavulanate clavulanic acid anion (2R,5R,Z)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-aza-bicyclo[3.2.0]heptane-2-carboxylate |
|
Definitions |
The conjugate base of clavulanic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_487869 |
|
charge |
-1 |
|
database_cross_reference |
PMID:25492589 |
|
definition |
The conjugate base of clavulanic acid. |
|
formula |
C8H8NO5 |
|
has_exact_synonym |
(2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate clavulanate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clavulanic acid anion (2R,5R,Z)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-aza-bicyclo[3.2.0]heptane-2-carboxylate |
|
id |
CHEBI:487869 |
|
in_subset | ||
inchi |
InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/p-1/b4-1-/t6-,7-/m1/s1 |
|
inchikey |
HZZVJAQRINQKSD-PBFISZAISA-M |
|
is conjugate base of | ||
label |
clavulanate |
|
mass |
198.15280 |
|
monoisotopicmass |
198.04080 |
|
notation |
CHEBI:487869 |
|
prefLabel |
clavulanate |
|
smiles |
[H][C@@]12CC(=O)N1[C@@H](C([O-])=O)\C(O2)=C\CO |
|
treeView | ||
subClassOf |