loading...| Preferred Name |
ethyl vanillin |
|
| Synonyms |
Ethyl vanillin 3-ethoxy-4-hydroxybenzaldehyde 4-hydroxy-3-ethoxybenzaldehyde ethyl protal 3-ethoxyprotocatechualdehyde bourbonal 2-Ethoxy-4-formylphenol vanilal |
|
| Definitions |
A member of the class of benzaldehydes that is vanillin in which the methoxy group is replaced by an ethoxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48408 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22146718 CAS:121-32-4 Reaxys:1073761 KEGG:D01086 Beilstein:1073761 Patent:CN101417931 Wikipedia:Ethylvanillin PMID:3160401 HMDB:HMDB0029665 PMID:20195833 Patent:WO2011042365 |
|
| definition |
A member of the class of benzaldehydes that is vanillin in which the methoxy group is replaced by an ethoxy group. |
|
| formula |
C9H10O3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:48389 CHEBI:31579 |
|
| has_exact_synonym |
Ethyl vanillin 3-ethoxy-4-hydroxybenzaldehyde |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-hydroxy-3-ethoxybenzaldehyde ethyl protal 3-ethoxyprotocatechualdehyde bourbonal 2-Ethoxy-4-formylphenol vanilal |
|
| id |
CHEBI:48408 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3 |
|
| inchikey |
CBOQJANXLMLOSS-UHFFFAOYSA-N |
|
| label |
ethyl vanillin |
|
| mass |
166.17390 |
|
| monoisotopicmass |
166.06299 |
|
| notation |
CHEBI:48408 |
|
| prefLabel |
ethyl vanillin |
|
| smiles |
[H]C(=O)c1ccc(O)c(OCC)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |