loading...| Preferred Name |
dihydrotachysterol |
|
| Synonyms |
(3S,5E,7E,10S,22E)-9,10-secoergosta-5,7,22-trien-3-ol Dihydrotachysterol dihydrotachysterol AT 10 dihydrotachysterolum Anti-tetany substance 10 dihidrotaquisterol |
|
| Definitions |
A hydroxy seco-steroid that is 9,10-secoergosta-5,7,22-triene substituted by a hydroxy group at position 3. A synthetic analogue of vitamin D that acts a bone density conservation agent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4591 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:2062504 KEGG:D00299 Wikipedia:Dihydrotachysterol DrugBank:DB01070 PMID:24766747 LIPID_MAPS_instance:LMST03010056 Drug_Central:2841 PMID:25075826 CAS:67-96-9 KEGG:C06957 |
|
| definition |
A hydroxy seco-steroid that is 9,10-secoergosta-5,7,22-triene substituted by a hydroxy group at position 3. A synthetic analogue of vitamin D that acts a bone density conservation agent. |
|
| formula |
C28H46O |
|
| has role | ||
| has_exact_synonym |
(3S,5E,7E,10S,22E)-9,10-secoergosta-5,7,22-trien-3-ol Dihydrotachysterol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dihydrotachysterol AT 10 dihydrotachysterolum Anti-tetany substance 10 dihidrotaquisterol |
|
| id |
CHEBI:4591 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H46O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-22,25-27,29H,7-8,11,14-18H2,1-6H3/b10-9+,23-12+,24-13+/t20-,21-,22+,25-,26+,27-,28+/m0/s1 |
|
| inchikey |
ILYCWAKSDCYMBB-OPCMSESCSA-N |
|
| label |
dihydrotachysterol |
|
| mass |
398.66424 |
|
| monoisotopicmass |
398.35487 |
|
| notation |
CHEBI:4591 |
|
| prefLabel |
dihydrotachysterol |
|
| smiles |
[H][C@@]1(CC[C@]2([H])[C@]1(C)CCC\C2=C/C=C1\C[C@@H](O)CC[C@@H]1C)[C@H](C)\C=C\[C@H](C)C(C)C |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_36819 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36819 |