loading...| Preferred Name |
perfluorodecalin |
|
| Synonyms |
octadecafluorodecahydronaphthalene perfluorodecalin FDC octadecafluorodecaline decahydrooctadecafluoronaphthalene Perflunafene 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene |
|
| Definitions |
A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38848 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:19682704 CAS:306-94-5 PMID:22006656 Wikipedia:Perfluorodecalin Beilstein:2067113 Drug_Central:2103 Gmelin:1438536 |
|
| definition |
A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
|
| formula |
C10F18 |
|
| has parent hydride | ||
| has role | ||
| has_exact_synonym |
octadecafluorodecahydronaphthalene perfluorodecalin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
FDC octadecafluorodecaline decahydrooctadecafluoronaphthalene Perflunafene 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene |
|
| id |
CHEBI:38848 |
|
| in_subset | ||
| inchi |
InChI=1S/C10F18/c11-1-2(12,5(17,18)9(25,26)7(21,22)3(1,13)14)6(19,20)10(27,28)8(23,24)4(1,15)16 |
|
| inchikey |
UWEYRJFJVCLAGH-UHFFFAOYSA-N |
|
| label |
perfluorodecalin |
|
| mass |
462.07826 |
|
| monoisotopicmass |
461.97126 |
|
| notation |
CHEBI:38848 |
|
| prefLabel |
perfluorodecalin |
|
| smiles |
FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)F |
|
| treeView | ||
| subClassOf |